About CID 72712429
CID 72712429 (PubChem CID 72712429) has the molecular formula C20H37BN2O4P
and a molecular weight of 411.31 g/mol.
Molecular Properties
| Compound Name | CID 72712429 |
| PubChem CID | 72712429 |
| Molecular Formula | C20H37BN2O4P |
| Molecular Weight | 411.31 g/mol |
| Exact Mass | 411.26 |
| IUPAC Name | — |
| SMILES | CCOP(=O)(OCC)C(N(OC(C)c1ccccn1)C(C)(C)C)C(C)(C)C.[B] |
| InChI | InChI=1S/C20H37N2O4P.B/c1-10-24-27(23,25-11-2)18(19(4,5)6)22(20(7,8)9)26-16(3)17-14-12-13-15-21-17;/h12-16,18H,10-11H2,1-9H3; |
| InChIKey | OLTABYWQWXCNKO-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 60.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 411.31 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze CID 72712429 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 72712429?
The IUPAC name of CID 72712429 (CID 72712429) is not available.
What is the SMILES notation for CID 72712429?
The canonical SMILES for CID 72712429 is CCOP(=O)(OCC)C(N(OC(C)c1ccccn1)C(C)(C)C)C(C)(C)C.[B].
What is the InChIKey of CID 72712429?
The InChIKey is OLTABYWQWXCNKO-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H37N2O4P.B/c1-10-24-27(23,25-11-2)18(19(4,5)6)22(20(7,8)9)26-16(3)17-14-12-13-15-21-17;/h12-16,18H,10-11H2,1-9H3;.
What are the key properties of CID 72712429?
CID 72712429 has a molecular weight of 411.31 g/mol, XLogP of 5.43, 9 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for CID 72712429 is sourced from PubChem (CID 72712429), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).