C31H35N7O2 — CID 72712891
7-[4-(1-methylpiperidin-4-yl)anilino]-3-phenyl-1-[(3S)-1-prop-2-enoylpyrrolidin-3-yl]-4H-pyrimido[4,5-d]pyrimidin-2-one (PubChem CID 72712891) has the molecular formula C31H35N7O2 and a molecular weight of 537.67 g/mol. Its IUPAC name is 7-[4-(1-methylpiperidin-4-yl)anilino]-3-phenyl-1-[(3S)-1-prop-2-enoylpyrrolidin-3-yl]-4H-pyrimido[4,5-d]pyrimidin-2-one.
| Compound Name | 7-[4-(1-methylpiperidin-4-yl)anilino]-3-phenyl-1-[(3S)-1-prop-2-enoylpyrrolidin-3-yl]-4H-pyrimido[4,5-d]pyrimidin-2-one |
|---|---|
| PubChem CID | 72712891 |
| Molecular Formula | C31H35N7O2 |
| Molecular Weight | 537.67 g/mol |
| Exact Mass | 537.29 |
| IUPAC Name | 7-[4-(1-methylpiperidin-4-yl)anilino]-3-phenyl-1-[(3S)-1-prop-2-enoylpyrrolidin-3-yl]-4H-pyrimido[4,5-d]pyrimidin-2-one |
| SMILES | C=CC(=O)N1CC[C@H](N2C(=O)N(c3ccccc3)Cc3cnc(Nc4ccc(C5CCN(C)CC5)cc4)nc32)C1 |
| InChI | InChI=1S/C31H35N7O2/c1-3-28(39)36-18-15-27(21-36)38-29-24(20-37(31(38)40)26-7-5-4-6-8-26)19-32-30(34-29)33-25-11-9-22(10-12-25)23-13-16-35(2)17-14-23/h3-12,19,23,27H,1,13-18,20-21H2,2H3,(H,32,33,34)/t27-/m0/s1 |
| InChIKey | MMNBFIZFTKJPBY-MHZLTWQESA-N |
| XLogP | 4.76 |
| TPSA | 84.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.67 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|