C17H15F2N7OS2 — CID 72713536
1-[5-[[1-[(2,6-difluorophenyl)methyl]-1,2,4-triazol-3-yl]amino]-1,3,4-thiadiazol-2-yl]-1-(4-methyl-1,3-thiazol-2-yl)ethanol (PubChem CID 72713536) has the molecular formula C17H15F2N7OS2 and a molecular weight of 435.49 g/mol. Its IUPAC name is 1-[5-[[1-[(2,6-difluorophenyl)methyl]-1,2,4-triazol-3-yl]amino]-1,3,4-thiadiazol-2-yl]-1-(4-methyl-1,3-thiazol-2-yl)ethanol.
| Compound Name | 1-[5-[[1-[(2,6-difluorophenyl)methyl]-1,2,4-triazol-3-yl]amino]-1,3,4-thiadiazol-2-yl]-1-(4-methyl-1,3-thiazol-2-yl)ethanol |
|---|---|
| PubChem CID | 72713536 |
| Molecular Formula | C17H15F2N7OS2 |
| Molecular Weight | 435.49 g/mol |
| Exact Mass | 435.07 |
| IUPAC Name | 1-[5-[[1-[(2,6-difluorophenyl)methyl]-1,2,4-triazol-3-yl]amino]-1,3,4-thiadiazol-2-yl]-1-(4-methyl-1,3-thiazol-2-yl)ethanol |
| SMILES | Cc1csc(C(C)(O)c2nnc(Nc3ncn(Cc4c(F)cccc4F)n3)s2)n1 |
| InChI | InChI=1S/C17H15F2N7OS2/c1-9-7-28-13(21-9)17(2,27)14-23-24-16(29-14)22-15-20-8-26(25-15)6-10-11(18)4-3-5-12(10)19/h3-5,7-8,27H,6H2,1-2H3,(H,22,24,25) |
| InChIKey | CHHHEJNQMGBWRA-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 101.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.49 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |