About 5-phenyl-4,7-dihydrotetrazolo[1,5-a]pyrimidine
5-phenyl-4,7-dihydrotetrazolo[1,5-a]pyrimidine (PubChem CID 727137) has the molecular formula C10H9N5
and a molecular weight of 199.22 g/mol. Its IUPAC name is 5-phenyl-4,7-dihydrotetrazolo[1,5-a]pyrimidine.
Molecular Properties
| Compound Name | 5-phenyl-4,7-dihydrotetrazolo[1,5-a]pyrimidine |
| PubChem CID | 727137 |
| Molecular Formula | C10H9N5 |
| Molecular Weight | 199.22 g/mol |
| Exact Mass | 199.09 |
| IUPAC Name | 5-phenyl-4,7-dihydrotetrazolo[1,5-a]pyrimidine |
| SMILES | C1=C(c2ccccc2)Nc2nnnn2C1 |
| InChI | InChI=1S/C10H9N5/c1-2-4-8(5-3-1)9-6-7-15-10(11-9)12-13-14-15/h1-6H,7H2,(H,11,12,14) |
| InChIKey | WTFRYRFNRVFFEJ-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 199.22 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-phenyl-4,7-dihydrotetrazolo[1,5-a]pyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-phenyl-4,7-dihydrotetrazolo[1,5-a]pyrimidine?
The IUPAC name of 5-phenyl-4,7-dihydrotetrazolo[1,5-a]pyrimidine (CID 727137) is 5-phenyl-4,7-dihydrotetrazolo[1,5-a]pyrimidine.
What is the SMILES notation for 5-phenyl-4,7-dihydrotetrazolo[1,5-a]pyrimidine?
The canonical SMILES for 5-phenyl-4,7-dihydrotetrazolo[1,5-a]pyrimidine is C1=C(c2ccccc2)Nc2nnnn2C1.
What is the InChIKey of 5-phenyl-4,7-dihydrotetrazolo[1,5-a]pyrimidine?
The InChIKey is WTFRYRFNRVFFEJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9N5/c1-2-4-8(5-3-1)9-6-7-15-10(11-9)12-13-14-15/h1-6H,7H2,(H,11,12,14).
What are the key properties of 5-phenyl-4,7-dihydrotetrazolo[1,5-a]pyrimidine?
5-phenyl-4,7-dihydrotetrazolo[1,5-a]pyrimidine has a molecular weight of 199.22 g/mol, XLogP of 1.14, 1 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-phenyl-4,7-dihydrotetrazolo[1,5-a]pyrimidine is sourced from PubChem (CID 727137), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).