C16H18Cl2N2O — CID 72713743
4,6-dichloro-N-[(1R,2S)-2-methylcyclohexyl]-1H-indole-2-carboxamide (PubChem CID 72713743) has the molecular formula C16H18Cl2N2O and a molecular weight of 325.24 g/mol. Its IUPAC name is 4,6-dichloro-N-[(1R,2S)-2-methylcyclohexyl]-1H-indole-2-carboxamide.
| Compound Name | 4,6-dichloro-N-[(1R,2S)-2-methylcyclohexyl]-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 72713743 |
| Molecular Formula | C16H18Cl2N2O |
| Molecular Weight | 325.24 g/mol |
| Exact Mass | 324.08 |
| IUPAC Name | 4,6-dichloro-N-[(1R,2S)-2-methylcyclohexyl]-1H-indole-2-carboxamide |
| SMILES | C[C@H]1CCCC[C@H]1NC(=O)c1cc2c(Cl)cc(Cl)cc2[nH]1 |
| InChI | InChI=1S/C16H18Cl2N2O/c1-9-4-2-3-5-13(9)20-16(21)15-8-11-12(18)6-10(17)7-14(11)19-15/h6-9,13,19H,2-5H2,1H3,(H,20,21)/t9-,13+/m0/s1 |
| InChIKey | JKXCORRVLFGYSE-TVQRCGJNSA-N |
| XLogP | 4.78 |
| TPSA | 44.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.24 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |