C19H26O5 — CID 72714036
tert-butyl (2S,3S)-2-hydroxy-3-[(2S,4S)-2-phenyl-1,3-dioxan-4-yl]pent-4-enoate (PubChem CID 72714036) has the molecular formula C19H26O5 and a molecular weight of 334.41 g/mol. Its IUPAC name is tert-butyl (2S,3S)-2-hydroxy-3-[(2S,4S)-2-phenyl-1,3-dioxan-4-yl]pent-4-enoate.
| Compound Name | tert-butyl (2S,3S)-2-hydroxy-3-[(2S,4S)-2-phenyl-1,3-dioxan-4-yl]pent-4-enoate |
|---|---|
| PubChem CID | 72714036 |
| Molecular Formula | C19H26O5 |
| Molecular Weight | 334.41 g/mol |
| Exact Mass | 334.18 |
| IUPAC Name | tert-butyl (2S,3S)-2-hydroxy-3-[(2S,4S)-2-phenyl-1,3-dioxan-4-yl]pent-4-enoate |
| SMILES | C=C[C@H]([C@@H]1CCO[C@H](c2ccccc2)O1)[C@H](O)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C19H26O5/c1-5-14(16(20)17(21)24-19(2,3)4)15-11-12-22-18(23-15)13-9-7-6-8-10-13/h5-10,14-16,18,20H,1,11-12H2,2-4H3/t14-,15+,16+,18+/m1/s1 |
| InChIKey | MTBBDYOCQZGQTE-CVYDXHPNSA-N |
| XLogP | 3.00 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.41 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|