C17H15ClF3N3OS — CID 72714095
3-amino-4,6-dimethyl-N-[(2,4,5-trifluorophenyl)methyl]thieno[2,3-b]pyridine-2-carboxamide;hydrochloride (PubChem CID 72714095) has the molecular formula C17H15ClF3N3OS and a molecular weight of 401.84 g/mol. Its IUPAC name is 3-amino-4,6-dimethyl-N-[(2,4,5-trifluorophenyl)methyl]thieno[2,3-b]pyridine-2-carboxamide;hydrochloride.
| Compound Name | 3-amino-4,6-dimethyl-N-[(2,4,5-trifluorophenyl)methyl]thieno[2,3-b]pyridine-2-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 72714095 |
| Molecular Formula | C17H15ClF3N3OS |
| Molecular Weight | 401.84 g/mol |
| Exact Mass | 401.06 |
| IUPAC Name | 3-amino-4,6-dimethyl-N-[(2,4,5-trifluorophenyl)methyl]thieno[2,3-b]pyridine-2-carboxamide;hydrochloride |
| SMILES | Cc1cc(C)c2c(N)c(C(=O)NCc3cc(F)c(F)cc3F)sc2n1.Cl |
| InChI | InChI=1S/C17H14F3N3OS.ClH/c1-7-3-8(2)23-17-13(7)14(21)15(25-17)16(24)22-6-9-4-11(19)12(20)5-10(9)18;/h3-5H,6,21H2,1-2H3,(H,22,24);1H |
| InChIKey | GPJHQBLETSSRJP-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.84 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|