C29H27F2N7O2 — CID 72714429
(E)-2-[(2S)-2-[[4-amino-3-[4-(2,5-difluorophenoxy)phenyl]pyrazolo[3,4-d]pyrimidin-1-yl]methyl]pyrrolidine-1-carbonyl]-4-methylpent-2-enenitrile (PubChem CID 72714429) has the molecular formula C29H27F2N7O2 and a molecular weight of 543.58 g/mol. Its IUPAC name is (E)-2-[(2S)-2-[[4-amino-3-[4-(2,5-difluorophenoxy)phenyl]pyrazolo[3,4-d]pyrimidin-1-yl]methyl]pyrrolidine-1-carbonyl]-4-methylpent-2-enenitrile.
| Compound Name | (E)-2-[(2S)-2-[[4-amino-3-[4-(2,5-difluorophenoxy)phenyl]pyrazolo[3,4-d]pyrimidin-1-yl]methyl]pyrrolidine-1-carbonyl]-4-methylpent-2-enenitrile |
|---|---|
| PubChem CID | 72714429 |
| Molecular Formula | C29H27F2N7O2 |
| Molecular Weight | 543.58 g/mol |
| Exact Mass | 543.22 |
| IUPAC Name | (E)-2-[(2S)-2-[[4-amino-3-[4-(2,5-difluorophenoxy)phenyl]pyrazolo[3,4-d]pyrimidin-1-yl]methyl]pyrrolidine-1-carbonyl]-4-methylpent-2-enenitrile |
| SMILES | CC(C)/C=C(\C#N)C(=O)N1CCC[C@H]1Cn1nc(-c2ccc(Oc3cc(F)ccc3F)cc2)c2c(N)ncnc21 |
| InChI | InChI=1S/C29H27F2N7O2/c1-17(2)12-19(14-32)29(39)37-11-3-4-21(37)15-38-28-25(27(33)34-16-35-28)26(36-38)18-5-8-22(9-6-18)40-24-13-20(30)7-10-23(24)31/h5-10,12-13,16-17,21H,3-4,11,15H2,1-2H3,(H2,33,34,35)/b19-12+/t21-/m0/s1 |
| InChIKey | GZOPCCOHXKUGIP-SRKIZSPNSA-N |
| XLogP | 5.24 |
| TPSA | 122.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.58 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|