C14H20O5 — CID 72714494
(5S,8S,9S,10R)-8-hydroxy-9-(hydroxymethyl)-5,9,10-trimethyl-4-oxatricyclo[6.3.0.01,5]undecane-3,11-dione (PubChem CID 72714494) has the molecular formula C14H20O5 and a molecular weight of 268.31 g/mol. Its IUPAC name is (5S,8S,9S,10R)-8-hydroxy-9-(hydroxymethyl)-5,9,10-trimethyl-4-oxatricyclo[6.3.0.01,5]undecane-3,11-dione.
| Compound Name | (5S,8S,9S,10R)-8-hydroxy-9-(hydroxymethyl)-5,9,10-trimethyl-4-oxatricyclo[6.3.0.01,5]undecane-3,11-dione |
|---|---|
| PubChem CID | 72714494 |
| Molecular Formula | C14H20O5 |
| Molecular Weight | 268.31 g/mol |
| Exact Mass | 268.13 |
| IUPAC Name | (5S,8S,9S,10R)-8-hydroxy-9-(hydroxymethyl)-5,9,10-trimethyl-4-oxatricyclo[6.3.0.01,5]undecane-3,11-dione |
| SMILES | C[C@H]1C(=O)C23CC(=O)O[C@@]2(C)CC[C@]3(O)[C@]1(C)CO |
| InChI | InChI=1S/C14H20O5/c1-8-10(17)13-6-9(16)19-12(13,3)4-5-14(13,18)11(8,2)7-15/h8,15,18H,4-7H2,1-3H3/t8-,11+,12-,13?,14-/m0/s1 |
| InChIKey | IYBOYWBAERKTFH-LJAGSLPJSA-N |
| XLogP | 0.42 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.31 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |