C28H40F4N6O2 — CID 72714542
6-methoxy-N-(1-propan-2-ylpiperidin-4-yl)-7-(3-pyrrolidin-1-ylpropoxy)-2-(3,3,4,4-tetrafluoropyrrolidin-1-yl)quinazolin-4-amine (PubChem CID 72714542) has the molecular formula C28H40F4N6O2 and a molecular weight of 568.66 g/mol. Its IUPAC name is 6-methoxy-N-(1-propan-2-ylpiperidin-4-yl)-7-(3-pyrrolidin-1-ylpropoxy)-2-(3,3,4,4-tetrafluoropyrrolidin-1-yl)quinazolin-4-amine.
| Compound Name | 6-methoxy-N-(1-propan-2-ylpiperidin-4-yl)-7-(3-pyrrolidin-1-ylpropoxy)-2-(3,3,4,4-tetrafluoropyrrolidin-1-yl)quinazolin-4-amine |
|---|---|
| PubChem CID | 72714542 |
| Molecular Formula | C28H40F4N6O2 |
| Molecular Weight | 568.66 g/mol |
| Exact Mass | 568.31 |
| IUPAC Name | 6-methoxy-N-(1-propan-2-ylpiperidin-4-yl)-7-(3-pyrrolidin-1-ylpropoxy)-2-(3,3,4,4-tetrafluoropyrrolidin-1-yl)quinazolin-4-amine |
| SMILES | COc1cc2c(NC3CCN(C(C)C)CC3)nc(N3CC(F)(F)C(F)(F)C3)nc2cc1OCCCN1CCCC1 |
| InChI | InChI=1S/C28H40F4N6O2/c1-19(2)37-12-7-20(8-13-37)33-25-21-15-23(39-3)24(40-14-6-11-36-9-4-5-10-36)16-22(21)34-26(35-25)38-17-27(29,30)28(31,32)18-38/h15-16,19-20H,4-14,17-18H2,1-3H3,(H,33,34,35) |
| InChIKey | PILLSKXLPRVYLP-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 65.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.66 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|