C31H47F2N5O2 — CID 72714643
2-cyclohexyl-7-[3-(4,4-difluoropiperidin-1-yl)propoxy]-6-methoxy-N-(1-propan-2-ylpiperidin-4-yl)quinazolin-4-amine (PubChem CID 72714643) has the molecular formula C31H47F2N5O2 and a molecular weight of 559.75 g/mol. Its IUPAC name is 2-cyclohexyl-7-[3-(4,4-difluoropiperidin-1-yl)propoxy]-6-methoxy-N-(1-propan-2-ylpiperidin-4-yl)quinazolin-4-amine.
| Compound Name | 2-cyclohexyl-7-[3-(4,4-difluoropiperidin-1-yl)propoxy]-6-methoxy-N-(1-propan-2-ylpiperidin-4-yl)quinazolin-4-amine |
|---|---|
| PubChem CID | 72714643 |
| Molecular Formula | C31H47F2N5O2 |
| Molecular Weight | 559.75 g/mol |
| Exact Mass | 559.37 |
| IUPAC Name | 2-cyclohexyl-7-[3-(4,4-difluoropiperidin-1-yl)propoxy]-6-methoxy-N-(1-propan-2-ylpiperidin-4-yl)quinazolin-4-amine |
| SMILES | COc1cc2c(NC3CCN(C(C)C)CC3)nc(C3CCCCC3)nc2cc1OCCCN1CCC(F)(F)CC1 |
| InChI | InChI=1S/C31H47F2N5O2/c1-22(2)38-15-10-24(11-16-38)34-30-25-20-27(39-3)28(40-19-7-14-37-17-12-31(32,33)13-18-37)21-26(25)35-29(36-30)23-8-5-4-6-9-23/h20-24H,4-19H2,1-3H3,(H,34,35,36) |
| InChIKey | RBIVSCSLAAWBKB-UHFFFAOYSA-N |
| XLogP | 6.47 |
| TPSA | 62.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.75 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|