About US9000184, 6, isomer 1
US9000184, 6, isomer 1 (PubChem CID 72714747) has the molecular formula C27H30N4O2
and a molecular weight of 442.56 g/mol.
Molecular Properties
| Compound Name | US9000184, 6, isomer 1 |
| PubChem CID | 72714747 |
| Molecular Formula | C27H30N4O2 |
| Molecular Weight | 442.56 g/mol |
| Exact Mass | 442.24 |
| IUPAC Name | — |
| SMILES | COc1cc(C#N)cc(-c2ccc3c(c2)C2(N=C(C)C(N)=N2)C2(CC3)CCC(OC)CC2)c1 |
| InChI | InChI=1S/C27H30N4O2/c1-17-25(29)31-27(30-17)24-15-20(21-12-18(16-28)13-23(14-21)33-3)5-4-19(24)6-9-26(27)10-7-22(32-2)8-11-26/h4-5,12-15,22H,6-11H2,1-3H3,(H2,29,31) |
| InChIKey | OOYVWTJLOZOKAU-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 92.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 442.56 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze US9000184, 6, isomer 1 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of US9000184, 6, isomer 1?
The IUPAC name of US9000184, 6, isomer 1 (CID 72714747) is not available.
What is the SMILES notation for US9000184, 6, isomer 1?
The canonical SMILES for US9000184, 6, isomer 1 is COc1cc(C#N)cc(-c2ccc3c(c2)C2(N=C(C)C(N)=N2)C2(CC3)CCC(OC)CC2)c1.
What is the InChIKey of US9000184, 6, isomer 1?
The InChIKey is OOYVWTJLOZOKAU-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H30N4O2/c1-17-25(29)31-27(30-17)24-15-20(21-12-18(16-28)13-23(14-21)33-3)5-4-19(24)6-9-26(27)10-7-22(32-2)8-11-26/h4-5,12-15,22H,6-11H2,1-3H3,(H2,29,31).
What are the key properties of US9000184, 6, isomer 1?
US9000184, 6, isomer 1 has a molecular weight of 442.56 g/mol, XLogP of 4.74, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for US9000184, 6, isomer 1 is sourced from PubChem (CID 72714747), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).