C30H46O5 — CID 72715005
(2R,3'S,4S,4'S,6R,8R,9S,10R,14S,17S)-2,4',8,10,14,18,18-heptamethylspiro[5-oxapentacyclo[11.8.0.02,10.04,9.014,19]henicosa-1(21),12-diene-6,2'-oxolane]-3',4',17-triol (PubChem CID 72715005) has the molecular formula C30H46O5 and a molecular weight of 486.69 g/mol. Its IUPAC name is (2R,3'S,4S,4'S,6R,8R,9S,10R,14S,17S)-2,4',8,10,14,18,18-heptamethylspiro[5-oxapentacyclo[11.8.0.02,10.04,9.014,19]henicosa-1(21),12-diene-6,2'-oxolane]-3',4',17-triol.
| Compound Name | (2R,3'S,4S,4'S,6R,8R,9S,10R,14S,17S)-2,4',8,10,14,18,18-heptamethylspiro[5-oxapentacyclo[11.8.0.02,10.04,9.014,19]henicosa-1(21),12-diene-6,2'-oxolane]-3',4',17-triol |
|---|---|
| PubChem CID | 72715005 |
| Molecular Formula | C30H46O5 |
| Molecular Weight | 486.69 g/mol |
| Exact Mass | 486.33 |
| IUPAC Name | (2R,3'S,4S,4'S,6R,8R,9S,10R,14S,17S)-2,4',8,10,14,18,18-heptamethylspiro[5-oxapentacyclo[11.8.0.02,10.04,9.014,19]henicosa-1(21),12-diene-6,2'-oxolane]-3',4',17-triol |
| SMILES | C[C@@H]1C[C@@]2(OC[C@](C)(O)[C@@H]2O)O[C@H]2C[C@@]3(C)C4=CCC5C(C)(C)[C@@H](O)CC[C@]5(C)C4=CC[C@]3(C)[C@H]12 |
| InChI | InChI=1S/C30H46O5/c1-17-14-30(24(32)29(7,33)16-34-30)35-20-15-28(6)19-8-9-21-25(2,3)22(31)11-12-26(21,4)18(19)10-13-27(28,5)23(17)20/h8,10,17,20-24,31-33H,9,11-16H2,1-7H3/t17-,20+,21?,22+,23-,24+,26-,27-,28+,29+,30-/m1/s1 |
| InChIKey | BDOVZLSMDAFYHY-OVQCJKHCSA-N |
| XLogP | 4.75 |
| TPSA | 79.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.69 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |