C18H9N3OS — CID 72715068
7-pyridin-3-yl-11-thia-2,8-diazatetracyclo[7.6.1.05,16.010,14]hexadeca-1,3,5,7,9(16),10(14),12-heptaen-15-one (PubChem CID 72715068) has the molecular formula C18H9N3OS and a molecular weight of 315.36 g/mol. Its IUPAC name is 7-pyridin-3-yl-11-thia-2,8-diazatetracyclo[7.6.1.05,16.010,14]hexadeca-1,3,5,7,9(16),10(14),12-heptaen-15-one.
| Compound Name | 7-pyridin-3-yl-11-thia-2,8-diazatetracyclo[7.6.1.05,16.010,14]hexadeca-1,3,5,7,9(16),10(14),12-heptaen-15-one |
|---|---|
| PubChem CID | 72715068 |
| Molecular Formula | C18H9N3OS |
| Molecular Weight | 315.36 g/mol |
| Exact Mass | 315.05 |
| IUPAC Name | 7-pyridin-3-yl-11-thia-2,8-diazatetracyclo[7.6.1.05,16.010,14]hexadeca-1,3,5,7,9(16),10(14),12-heptaen-15-one |
| SMILES | O=C1c2ccsc2-c2nc(-c3cccnc3)cc3ccnc1c23 |
| InChI | InChI=1S/C18H9N3OS/c22-17-12-4-7-23-18(12)16-14-10(3-6-20-15(14)17)8-13(21-16)11-2-1-5-19-9-11/h1-9H |
| InChIKey | OEMXFFIBMWXXEW-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 55.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.36 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |