C24H25NO2 — CID 72715094
(2S,3S,4R)-6-methoxy-4-(4-methoxyphenyl)-3-methyl-2-phenyl-1,2,3,4-tetrahydroquinoline (PubChem CID 72715094) has the molecular formula C24H25NO2 and a molecular weight of 359.47 g/mol. Its IUPAC name is (2S,3S,4R)-6-methoxy-4-(4-methoxyphenyl)-3-methyl-2-phenyl-1,2,3,4-tetrahydroquinoline.
| Compound Name | (2S,3S,4R)-6-methoxy-4-(4-methoxyphenyl)-3-methyl-2-phenyl-1,2,3,4-tetrahydroquinoline |
|---|---|
| PubChem CID | 72715094 |
| Molecular Formula | C24H25NO2 |
| Molecular Weight | 359.47 g/mol |
| Exact Mass | 359.19 |
| IUPAC Name | (2S,3S,4R)-6-methoxy-4-(4-methoxyphenyl)-3-methyl-2-phenyl-1,2,3,4-tetrahydroquinoline |
| SMILES | COc1ccc([C@@H]2c3cc(OC)ccc3N[C@H](c3ccccc3)[C@H]2C)cc1 |
| InChI | InChI=1S/C24H25NO2/c1-16-23(17-9-11-19(26-2)12-10-17)21-15-20(27-3)13-14-22(21)25-24(16)18-7-5-4-6-8-18/h4-16,23-25H,1-3H3/t16-,23+,24-/m0/s1 |
| InChIKey | SJKWGHPDDCNDII-GHEQTVGYSA-N |
| XLogP | 5.64 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.47 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|