About (3S,4R)-1-benzyl-6-methoxy-4-(4-methoxyphenyl)-3-methyl-3,4-dihydro-2H-quinoline
(3S,4R)-1-benzyl-6-methoxy-4-(4-methoxyphenyl)-3-methyl-3,4-dihydro-2H-quinoline (PubChem CID 72715095) has the molecular formula C25H27NO2
and a molecular weight of 373.50 g/mol. Its IUPAC name is (3S,4R)-1-benzyl-6-methoxy-4-(4-methoxyphenyl)-3-methyl-3,4-dihydro-2H-quinoline.
Molecular Properties
| Compound Name | (3S,4R)-1-benzyl-6-methoxy-4-(4-methoxyphenyl)-3-methyl-3,4-dihydro-2H-quinoline |
| PubChem CID | 72715095 |
| Molecular Formula | C25H27NO2 |
| Molecular Weight | 373.50 g/mol |
| Exact Mass | 373.20 |
| IUPAC Name | (3S,4R)-1-benzyl-6-methoxy-4-(4-methoxyphenyl)-3-methyl-3,4-dihydro-2H-quinoline |
| SMILES | COc1ccc([C@@H]2c3cc(OC)ccc3N(Cc3ccccc3)C[C@H]2C)cc1 |
| InChI | InChI=1S/C25H27NO2/c1-18-16-26(17-19-7-5-4-6-8-19)24-14-13-22(28-3)15-23(24)25(18)20-9-11-21(27-2)12-10-20/h4-15,18,25H,16-17H2,1-3H3/t18-,25-/m1/s1 |
| InChIKey | KUPQUUWZDBYIDQ-IQGLISFBSA-N |
| XLogP | 5.49 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 373.50 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|
Analyze (3S,4R)-1-benzyl-6-methoxy-4-(4-methoxyphenyl)-3-methyl-3,4-dihydro-2H-quinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S,4R)-1-benzyl-6-methoxy-4-(4-methoxyphenyl)-3-methyl-3,4-dihydro-2H-quinoline?
The IUPAC name of (3S,4R)-1-benzyl-6-methoxy-4-(4-methoxyphenyl)-3-methyl-3,4-dihydro-2H-quinoline (CID 72715095) is (3S,4R)-1-benzyl-6-methoxy-4-(4-methoxyphenyl)-3-methyl-3,4-dihydro-2H-quinoline.
What is the SMILES notation for (3S,4R)-1-benzyl-6-methoxy-4-(4-methoxyphenyl)-3-methyl-3,4-dihydro-2H-quinoline?
The canonical SMILES for (3S,4R)-1-benzyl-6-methoxy-4-(4-methoxyphenyl)-3-methyl-3,4-dihydro-2H-quinoline is COc1ccc([C@@H]2c3cc(OC)ccc3N(Cc3ccccc3)C[C@H]2C)cc1.
What is the InChIKey of (3S,4R)-1-benzyl-6-methoxy-4-(4-methoxyphenyl)-3-methyl-3,4-dihydro-2H-quinoline?
The InChIKey is KUPQUUWZDBYIDQ-IQGLISFBSA-N. The full InChI is InChI=1S/C25H27NO2/c1-18-16-26(17-19-7-5-4-6-8-19)24-14-13-22(28-3)15-23(24)25(18)20-9-11-21(27-2)12-10-20/h4-15,18,25H,16-17H2,1-3H3/t18-,25-/m1/s1.
What are the key properties of (3S,4R)-1-benzyl-6-methoxy-4-(4-methoxyphenyl)-3-methyl-3,4-dihydro-2H-quinoline?
(3S,4R)-1-benzyl-6-methoxy-4-(4-methoxyphenyl)-3-methyl-3,4-dihydro-2H-quinoline has a molecular weight of 373.50 g/mol, XLogP of 5.49, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3S,4R)-1-benzyl-6-methoxy-4-(4-methoxyphenyl)-3-methyl-3,4-dihydro-2H-quinoline is sourced from PubChem (CID 72715095), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).