About 11,11a-dihydro-6aH-pyrido[2,3-a]carbazole
11,11a-dihydro-6aH-pyrido[2,3-a]carbazole (PubChem CID 72715327) has the molecular formula C15H12N2
and a molecular weight of 220.28 g/mol. Its IUPAC name is 11,11a-dihydro-6aH-pyrido[2,3-a]carbazole.
Molecular Properties
| Compound Name | 11,11a-dihydro-6aH-pyrido[2,3-a]carbazole |
| PubChem CID | 72715327 |
| Molecular Formula | C15H12N2 |
| Molecular Weight | 220.28 g/mol |
| Exact Mass | 220.10 |
| IUPAC Name | 11,11a-dihydro-6aH-pyrido[2,3-a]carbazole |
| SMILES | C1=CC2c3ccccc3NC2c2ncccc21 |
| InChI | InChI=1S/C15H12N2/c1-2-6-13-11(5-1)12-8-7-10-4-3-9-16-14(10)15(12)17-13/h1-9,12,15,17H |
| InChIKey | CLUGUOWKQVIJDE-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.28 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 11,11a-dihydro-6aH-pyrido[2,3-a]carbazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 11,11a-dihydro-6aH-pyrido[2,3-a]carbazole?
The IUPAC name of 11,11a-dihydro-6aH-pyrido[2,3-a]carbazole (CID 72715327) is 11,11a-dihydro-6aH-pyrido[2,3-a]carbazole.
What is the SMILES notation for 11,11a-dihydro-6aH-pyrido[2,3-a]carbazole?
The canonical SMILES for 11,11a-dihydro-6aH-pyrido[2,3-a]carbazole is C1=CC2c3ccccc3NC2c2ncccc21.
What is the InChIKey of 11,11a-dihydro-6aH-pyrido[2,3-a]carbazole?
The InChIKey is CLUGUOWKQVIJDE-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H12N2/c1-2-6-13-11(5-1)12-8-7-10-4-3-9-16-14(10)15(12)17-13/h1-9,12,15,17H.
What are the key properties of 11,11a-dihydro-6aH-pyrido[2,3-a]carbazole?
11,11a-dihydro-6aH-pyrido[2,3-a]carbazole has a molecular weight of 220.28 g/mol, XLogP of 3.36, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 11,11a-dihydro-6aH-pyrido[2,3-a]carbazole is sourced from PubChem (CID 72715327), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).