C23H26N8 — CID 72715463
N-cyano-N'-(2-methylphenyl)-2-propan-2-yl-4-pyrido[2,3-b]pyrazin-6-ylpiperazine-1-carboximidamide (PubChem CID 72715463) has the molecular formula C23H26N8 and a molecular weight of 414.52 g/mol. Its IUPAC name is N-cyano-N'-(2-methylphenyl)-2-propan-2-yl-4-pyrido[2,3-b]pyrazin-6-ylpiperazine-1-carboximidamide.
| Compound Name | N-cyano-N'-(2-methylphenyl)-2-propan-2-yl-4-pyrido[2,3-b]pyrazin-6-ylpiperazine-1-carboximidamide |
|---|---|
| PubChem CID | 72715463 |
| Molecular Formula | C23H26N8 |
| Molecular Weight | 414.52 g/mol |
| Exact Mass | 414.23 |
| IUPAC Name | N-cyano-N'-(2-methylphenyl)-2-propan-2-yl-4-pyrido[2,3-b]pyrazin-6-ylpiperazine-1-carboximidamide |
| SMILES | Cc1ccccc1/N=C(\NC#N)N1CCN(c2ccc3nccnc3n2)CC1C(C)C |
| InChI | InChI=1S/C23H26N8/c1-16(2)20-14-30(21-9-8-19-22(29-21)26-11-10-25-19)12-13-31(20)23(27-15-24)28-18-7-5-4-6-17(18)3/h4-11,16,20H,12-14H2,1-3H3,(H,27,28) |
| InChIKey | MMHLFRXOPOMMKB-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 93.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.52 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|