C35H30N2O2S2 — CID 72715659
1-S,9-S-bis[4-(4-cyanophenyl)phenyl] nonanebis(thioate) (PubChem CID 72715659) has the molecular formula C35H30N2O2S2 and a molecular weight of 574.77 g/mol. Its IUPAC name is 1-S,9-S-bis[4-(4-cyanophenyl)phenyl] nonanebis(thioate).
| Compound Name | 1-S,9-S-bis[4-(4-cyanophenyl)phenyl] nonanebis(thioate) |
|---|---|
| PubChem CID | 72715659 |
| Molecular Formula | C35H30N2O2S2 |
| Molecular Weight | 574.77 g/mol |
| Exact Mass | 574.17 |
| IUPAC Name | 1-S,9-S-bis[4-(4-cyanophenyl)phenyl] nonanebis(thioate) |
| SMILES | N#Cc1ccc(-c2ccc(SC(=O)CCCCCCCC(=O)Sc3ccc(-c4ccc(C#N)cc4)cc3)cc2)cc1 |
| InChI | InChI=1S/C35H30N2O2S2/c36-24-26-8-12-28(13-9-26)30-16-20-32(21-17-30)40-34(38)6-4-2-1-3-5-7-35(39)41-33-22-18-31(19-23-33)29-14-10-27(25-37)11-15-29/h8-23H,1-7H2 |
| InChIKey | YAFKJEGAOZXQHH-UHFFFAOYSA-N |
| XLogP | 9.43 |
| TPSA | 81.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.77 |
| LogP ≤ 5 | 9.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|