C18H26N2OS — CID 72715890
(3aR,6S,6aR,9aS,9bS)-6-ethyl-1-(1,3-thiazol-2-ylmethyl)-3,3a,4,6,6a,7,8,9,9a,9b-decahydro-2H-benzo[de]quinolin-5-one (PubChem CID 72715890) has the molecular formula C18H26N2OS and a molecular weight of 318.49 g/mol. Its IUPAC name is (3aR,6S,6aR,9aS,9bS)-6-ethyl-1-(1,3-thiazol-2-ylmethyl)-3,3a,4,6,6a,7,8,9,9a,9b-decahydro-2H-benzo[de]quinolin-5-one.
| Compound Name | (3aR,6S,6aR,9aS,9bS)-6-ethyl-1-(1,3-thiazol-2-ylmethyl)-3,3a,4,6,6a,7,8,9,9a,9b-decahydro-2H-benzo[de]quinolin-5-one |
|---|---|
| PubChem CID | 72715890 |
| Molecular Formula | C18H26N2OS |
| Molecular Weight | 318.49 g/mol |
| Exact Mass | 318.18 |
| IUPAC Name | (3aR,6S,6aR,9aS,9bS)-6-ethyl-1-(1,3-thiazol-2-ylmethyl)-3,3a,4,6,6a,7,8,9,9a,9b-decahydro-2H-benzo[de]quinolin-5-one |
| SMILES | CC[C@@H]1C(=O)C[C@H]2CCN(Cc3nccs3)[C@H]3CCC[C@@H]1[C@H]23 |
| InChI | InChI=1S/C18H26N2OS/c1-2-13-14-4-3-5-15-18(14)12(10-16(13)21)6-8-20(15)11-17-19-7-9-22-17/h7,9,12-15,18H,2-6,8,10-11H2,1H3/t12-,13+,14+,15+,18+/m1/s1 |
| InChIKey | SRNPPJMAFPXHFT-ZVZLPEGASA-N |
| XLogP | 3.75 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.49 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |