About (5-methoxy-1-benzofuran-2-yl)methyl carbamimidothioate;hydrobromide
(5-methoxy-1-benzofuran-2-yl)methyl carbamimidothioate;hydrobromide (PubChem CID 72716152) has the molecular formula C11H13BrN2O2S
and a molecular weight of 317.21 g/mol. Its IUPAC name is (5-methoxy-1-benzofuran-2-yl)methyl carbamimidothioate;hydrobromide.
Molecular Properties
| Compound Name | (5-methoxy-1-benzofuran-2-yl)methyl carbamimidothioate;hydrobromide |
| PubChem CID | 72716152 |
| Molecular Formula | C11H13BrN2O2S |
| Molecular Weight | 317.21 g/mol |
| Exact Mass | 315.99 |
| IUPAC Name | (5-methoxy-1-benzofuran-2-yl)methyl carbamimidothioate;hydrobromide |
| SMILES | Br.[H]/N=C(\N)SCc1cc2cc(OC)ccc2o1 |
| InChI | InChI=1S/C11H12N2O2S.BrH/c1-14-8-2-3-10-7(4-8)5-9(15-10)6-16-11(12)13;/h2-5H,6H2,1H3,(H3,12,13);1H |
| InChIKey | JSUQADQEHTWXQB-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 72.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 317.21 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze (5-methoxy-1-benzofuran-2-yl)methyl carbamimidothioate;hydrobromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5-methoxy-1-benzofuran-2-yl)methyl carbamimidothioate;hydrobromide?
The IUPAC name of (5-methoxy-1-benzofuran-2-yl)methyl carbamimidothioate;hydrobromide (CID 72716152) is (5-methoxy-1-benzofuran-2-yl)methyl carbamimidothioate;hydrobromide.
What is the SMILES notation for (5-methoxy-1-benzofuran-2-yl)methyl carbamimidothioate;hydrobromide?
The canonical SMILES for (5-methoxy-1-benzofuran-2-yl)methyl carbamimidothioate;hydrobromide is Br.[H]/N=C(\N)SCc1cc2cc(OC)ccc2o1.
What is the InChIKey of (5-methoxy-1-benzofuran-2-yl)methyl carbamimidothioate;hydrobromide?
The InChIKey is JSUQADQEHTWXQB-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12N2O2S.BrH/c1-14-8-2-3-10-7(4-8)5-9(15-10)6-16-11(12)13;/h2-5H,6H2,1H3,(H3,12,13);1H.
What are the key properties of (5-methoxy-1-benzofuran-2-yl)methyl carbamimidothioate;hydrobromide?
(5-methoxy-1-benzofuran-2-yl)methyl carbamimidothioate;hydrobromide has a molecular weight of 317.21 g/mol, XLogP of 3.15, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (5-methoxy-1-benzofuran-2-yl)methyl carbamimidothioate;hydrobromide is sourced from PubChem (CID 72716152), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).