About [1-(2,3,4-trifluorophenyl)tetrazol-5-yl]methanamine;hydrochloride
[1-(2,3,4-trifluorophenyl)tetrazol-5-yl]methanamine;hydrochloride (PubChem CID 72716172) has the molecular formula C8H7ClF3N5
and a molecular weight of 265.63 g/mol. Its IUPAC name is [1-(2,3,4-trifluorophenyl)tetrazol-5-yl]methanamine;hydrochloride.
Molecular Properties
| Compound Name | [1-(2,3,4-trifluorophenyl)tetrazol-5-yl]methanamine;hydrochloride |
| PubChem CID | 72716172 |
| Molecular Formula | C8H7ClF3N5 |
| Molecular Weight | 265.63 g/mol |
| Exact Mass | 265.03 |
| IUPAC Name | [1-(2,3,4-trifluorophenyl)tetrazol-5-yl]methanamine;hydrochloride |
| SMILES | Cl.NCc1nnnn1-c1ccc(F)c(F)c1F |
| InChI | InChI=1S/C8H6F3N5.ClH/c9-4-1-2-5(8(11)7(4)10)16-6(3-12)13-14-15-16;/h1-2H,3,12H2;1H |
| InChIKey | LZXFUJDVRDXMCY-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 69.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 265.63 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|
Analyze [1-(2,3,4-trifluorophenyl)tetrazol-5-yl]methanamine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-(2,3,4-trifluorophenyl)tetrazol-5-yl]methanamine;hydrochloride?
The IUPAC name of [1-(2,3,4-trifluorophenyl)tetrazol-5-yl]methanamine;hydrochloride (CID 72716172) is [1-(2,3,4-trifluorophenyl)tetrazol-5-yl]methanamine;hydrochloride.
What is the SMILES notation for [1-(2,3,4-trifluorophenyl)tetrazol-5-yl]methanamine;hydrochloride?
The canonical SMILES for [1-(2,3,4-trifluorophenyl)tetrazol-5-yl]methanamine;hydrochloride is Cl.NCc1nnnn1-c1ccc(F)c(F)c1F.
What is the InChIKey of [1-(2,3,4-trifluorophenyl)tetrazol-5-yl]methanamine;hydrochloride?
The InChIKey is LZXFUJDVRDXMCY-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6F3N5.ClH/c9-4-1-2-5(8(11)7(4)10)16-6(3-12)13-14-15-16;/h1-2H,3,12H2;1H.
What are the key properties of [1-(2,3,4-trifluorophenyl)tetrazol-5-yl]methanamine;hydrochloride?
[1-(2,3,4-trifluorophenyl)tetrazol-5-yl]methanamine;hydrochloride has a molecular weight of 265.63 g/mol, XLogP of 0.96, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [1-(2,3,4-trifluorophenyl)tetrazol-5-yl]methanamine;hydrochloride is sourced from PubChem (CID 72716172), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).