About 4-[(dipropylamino)methyl]-1,3-thiazol-2-amine;dihydrochloride
4-[(dipropylamino)methyl]-1,3-thiazol-2-amine;dihydrochloride (PubChem CID 72716242) has the molecular formula C10H21Cl2N3S
and a molecular weight of 286.27 g/mol. Its IUPAC name is 4-[(dipropylamino)methyl]-1,3-thiazol-2-amine;dihydrochloride.
Molecular Properties
| Compound Name | 4-[(dipropylamino)methyl]-1,3-thiazol-2-amine;dihydrochloride |
| PubChem CID | 72716242 |
| Molecular Formula | C10H21Cl2N3S |
| Molecular Weight | 286.27 g/mol |
| Exact Mass | 285.08 |
| IUPAC Name | 4-[(dipropylamino)methyl]-1,3-thiazol-2-amine;dihydrochloride |
| SMILES | CCCN(CCC)Cc1csc(N)n1.Cl.Cl |
| InChI | InChI=1S/C10H19N3S.2ClH/c1-3-5-13(6-4-2)7-9-8-14-10(11)12-9;;/h8H,3-7H2,1-2H3,(H2,11,12);2*1H |
| InChIKey | WOHWHFFVHZLPJY-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 42.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 286.27 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-[(dipropylamino)methyl]-1,3-thiazol-2-amine;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(dipropylamino)methyl]-1,3-thiazol-2-amine;dihydrochloride?
The IUPAC name of 4-[(dipropylamino)methyl]-1,3-thiazol-2-amine;dihydrochloride (CID 72716242) is 4-[(dipropylamino)methyl]-1,3-thiazol-2-amine;dihydrochloride.
What is the SMILES notation for 4-[(dipropylamino)methyl]-1,3-thiazol-2-amine;dihydrochloride?
The canonical SMILES for 4-[(dipropylamino)methyl]-1,3-thiazol-2-amine;dihydrochloride is CCCN(CCC)Cc1csc(N)n1.Cl.Cl.
What is the InChIKey of 4-[(dipropylamino)methyl]-1,3-thiazol-2-amine;dihydrochloride?
The InChIKey is WOHWHFFVHZLPJY-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H19N3S.2ClH/c1-3-5-13(6-4-2)7-9-8-14-10(11)12-9;;/h8H,3-7H2,1-2H3,(H2,11,12);2*1H.
What are the key properties of 4-[(dipropylamino)methyl]-1,3-thiazol-2-amine;dihydrochloride?
4-[(dipropylamino)methyl]-1,3-thiazol-2-amine;dihydrochloride has a molecular weight of 286.27 g/mol, XLogP of 3.19, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(dipropylamino)methyl]-1,3-thiazol-2-amine;dihydrochloride is sourced from PubChem (CID 72716242), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).