About 2-methyl-5-(2-piperidin-4-ylethylsulfanyl)-1,3,4-thiadiazole;hydrochloride
2-methyl-5-(2-piperidin-4-ylethylsulfanyl)-1,3,4-thiadiazole;hydrochloride (PubChem CID 72716658) has the molecular formula C10H18ClN3S2
and a molecular weight of 279.86 g/mol. Its IUPAC name is 2-methyl-5-(2-piperidin-4-ylethylsulfanyl)-1,3,4-thiadiazole;hydrochloride.
Molecular Properties
| Compound Name | 2-methyl-5-(2-piperidin-4-ylethylsulfanyl)-1,3,4-thiadiazole;hydrochloride |
| PubChem CID | 72716658 |
| Molecular Formula | C10H18ClN3S2 |
| Molecular Weight | 279.86 g/mol |
| Exact Mass | 279.06 |
| IUPAC Name | 2-methyl-5-(2-piperidin-4-ylethylsulfanyl)-1,3,4-thiadiazole;hydrochloride |
| SMILES | Cc1nnc(SCCC2CCNCC2)s1.Cl |
| InChI | InChI=1S/C10H17N3S2.ClH/c1-8-12-13-10(15-8)14-7-4-9-2-5-11-6-3-9;/h9,11H,2-7H2,1H3;1H |
| InChIKey | JLGYYCZHPQZJSR-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 279.86 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-methyl-5-(2-piperidin-4-ylethylsulfanyl)-1,3,4-thiadiazole;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-5-(2-piperidin-4-ylethylsulfanyl)-1,3,4-thiadiazole;hydrochloride?
The IUPAC name of 2-methyl-5-(2-piperidin-4-ylethylsulfanyl)-1,3,4-thiadiazole;hydrochloride (CID 72716658) is 2-methyl-5-(2-piperidin-4-ylethylsulfanyl)-1,3,4-thiadiazole;hydrochloride.
What is the SMILES notation for 2-methyl-5-(2-piperidin-4-ylethylsulfanyl)-1,3,4-thiadiazole;hydrochloride?
The canonical SMILES for 2-methyl-5-(2-piperidin-4-ylethylsulfanyl)-1,3,4-thiadiazole;hydrochloride is Cc1nnc(SCCC2CCNCC2)s1.Cl.
What is the InChIKey of 2-methyl-5-(2-piperidin-4-ylethylsulfanyl)-1,3,4-thiadiazole;hydrochloride?
The InChIKey is JLGYYCZHPQZJSR-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H17N3S2.ClH/c1-8-12-13-10(15-8)14-7-4-9-2-5-11-6-3-9;/h9,11H,2-7H2,1H3;1H.
What are the key properties of 2-methyl-5-(2-piperidin-4-ylethylsulfanyl)-1,3,4-thiadiazole;hydrochloride?
2-methyl-5-(2-piperidin-4-ylethylsulfanyl)-1,3,4-thiadiazole;hydrochloride has a molecular weight of 279.86 g/mol, XLogP of 2.75, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-5-(2-piperidin-4-ylethylsulfanyl)-1,3,4-thiadiazole;hydrochloride is sourced from PubChem (CID 72716658), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).