About 4-(azetidin-3-yloxy)-1,6-dimethylpyridin-2-one
4-(azetidin-3-yloxy)-1,6-dimethylpyridin-2-one (PubChem CID 72716696) has the molecular formula C10H14N2O2
and a molecular weight of 194.23 g/mol. Its IUPAC name is 4-(azetidin-3-yloxy)-1,6-dimethylpyridin-2-one.
Molecular Properties
| Compound Name | 4-(azetidin-3-yloxy)-1,6-dimethylpyridin-2-one |
| PubChem CID | 72716696 |
| Molecular Formula | C10H14N2O2 |
| Molecular Weight | 194.23 g/mol |
| Exact Mass | 194.11 |
| IUPAC Name | 4-(azetidin-3-yloxy)-1,6-dimethylpyridin-2-one |
| SMILES | Cc1cc(OC2CNC2)cc(=O)n1C |
| InChI | InChI=1S/C10H14N2O2/c1-7-3-8(4-10(13)12(7)2)14-9-5-11-6-9/h3-4,9,11H,5-6H2,1-2H3 |
| InChIKey | CDTMNAYBZJBZRV-UHFFFAOYSA-N |
| XLogP | 0.04 |
| TPSA | 43.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.23 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-(azetidin-3-yloxy)-1,6-dimethylpyridin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(azetidin-3-yloxy)-1,6-dimethylpyridin-2-one?
The IUPAC name of 4-(azetidin-3-yloxy)-1,6-dimethylpyridin-2-one (CID 72716696) is 4-(azetidin-3-yloxy)-1,6-dimethylpyridin-2-one.
What is the SMILES notation for 4-(azetidin-3-yloxy)-1,6-dimethylpyridin-2-one?
The canonical SMILES for 4-(azetidin-3-yloxy)-1,6-dimethylpyridin-2-one is Cc1cc(OC2CNC2)cc(=O)n1C.
What is the InChIKey of 4-(azetidin-3-yloxy)-1,6-dimethylpyridin-2-one?
The InChIKey is CDTMNAYBZJBZRV-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14N2O2/c1-7-3-8(4-10(13)12(7)2)14-9-5-11-6-9/h3-4,9,11H,5-6H2,1-2H3.
What are the key properties of 4-(azetidin-3-yloxy)-1,6-dimethylpyridin-2-one?
4-(azetidin-3-yloxy)-1,6-dimethylpyridin-2-one has a molecular weight of 194.23 g/mol, XLogP of 0.04, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(azetidin-3-yloxy)-1,6-dimethylpyridin-2-one is sourced from PubChem (CID 72716696), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).