C16H17N5O4S — CID 72717084
2-[[2-(3,5-dimethyl-1,2-oxazol-4-yl)acetyl]amino]-N-(4,5-dimethyl-1,3-thiazol-2-yl)-1,3-oxazole-4-carboxamide (PubChem CID 72717084) has the molecular formula C16H17N5O4S and a molecular weight of 375.41 g/mol. Its IUPAC name is 2-[[2-(3,5-dimethyl-1,2-oxazol-4-yl)acetyl]amino]-N-(4,5-dimethyl-1,3-thiazol-2-yl)-1,3-oxazole-4-carboxamide.
| Compound Name | 2-[[2-(3,5-dimethyl-1,2-oxazol-4-yl)acetyl]amino]-N-(4,5-dimethyl-1,3-thiazol-2-yl)-1,3-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 72717084 |
| Molecular Formula | C16H17N5O4S |
| Molecular Weight | 375.41 g/mol |
| Exact Mass | 375.10 |
| IUPAC Name | 2-[[2-(3,5-dimethyl-1,2-oxazol-4-yl)acetyl]amino]-N-(4,5-dimethyl-1,3-thiazol-2-yl)-1,3-oxazole-4-carboxamide |
| SMILES | Cc1nc(NC(=O)c2coc(NC(=O)Cc3c(C)noc3C)n2)sc1C |
| InChI | InChI=1S/C16H17N5O4S/c1-7-10(4)26-16(17-7)20-14(23)12-6-24-15(18-12)19-13(22)5-11-8(2)21-25-9(11)3/h6H,5H2,1-4H3,(H,17,20,23)(H,18,19,22) |
| InChIKey | ZKHVWVZFXSXOPC-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 123.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.41 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |