C12H13BrN4O2 — CID 72718232
5-bromo-N-[[4-(dimethylamino)pyrimidin-2-yl]methyl]furan-2-carboxamide (PubChem CID 72718232) has the molecular formula C12H13BrN4O2 and a molecular weight of 325.17 g/mol. Its IUPAC name is 5-bromo-N-[[4-(dimethylamino)pyrimidin-2-yl]methyl]furan-2-carboxamide.
| Compound Name | 5-bromo-N-[[4-(dimethylamino)pyrimidin-2-yl]methyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 72718232 |
| Molecular Formula | C12H13BrN4O2 |
| Molecular Weight | 325.17 g/mol |
| Exact Mass | 324.02 |
| IUPAC Name | 5-bromo-N-[[4-(dimethylamino)pyrimidin-2-yl]methyl]furan-2-carboxamide |
| SMILES | CN(C)c1ccnc(CNC(=O)c2ccc(Br)o2)n1 |
| InChI | InChI=1S/C12H13BrN4O2/c1-17(2)11-5-6-14-10(16-11)7-15-12(18)8-3-4-9(13)19-8/h3-6H,7H2,1-2H3,(H,15,18) |
| InChIKey | WVPNHGCICVWQSI-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 71.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.17 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |