About N-[[4-(dimethylamino)pyrimidin-2-yl]methyl]-2,2-diphenylacetamide
N-[[4-(dimethylamino)pyrimidin-2-yl]methyl]-2,2-diphenylacetamide (PubChem CID 72718239) has the molecular formula C21H22N4O
and a molecular weight of 346.43 g/mol. Its IUPAC name is N-[[4-(dimethylamino)pyrimidin-2-yl]methyl]-2,2-diphenylacetamide.
Molecular Properties
| Compound Name | N-[[4-(dimethylamino)pyrimidin-2-yl]methyl]-2,2-diphenylacetamide |
| PubChem CID | 72718239 |
| Molecular Formula | C21H22N4O |
| Molecular Weight | 346.43 g/mol |
| Exact Mass | 346.18 |
| IUPAC Name | N-[[4-(dimethylamino)pyrimidin-2-yl]methyl]-2,2-diphenylacetamide |
| SMILES | CN(C)c1ccnc(CNC(=O)C(c2ccccc2)c2ccccc2)n1 |
| InChI | InChI=1S/C21H22N4O/c1-25(2)19-13-14-22-18(24-19)15-23-21(26)20(16-9-5-3-6-10-16)17-11-7-4-8-12-17/h3-14,20H,15H2,1-2H3,(H,23,26) |
| InChIKey | CPFIBHFJEMQJSF-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 346.43 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-[[4-(dimethylamino)pyrimidin-2-yl]methyl]-2,2-diphenylacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[[4-(dimethylamino)pyrimidin-2-yl]methyl]-2,2-diphenylacetamide?
The IUPAC name of N-[[4-(dimethylamino)pyrimidin-2-yl]methyl]-2,2-diphenylacetamide (CID 72718239) is N-[[4-(dimethylamino)pyrimidin-2-yl]methyl]-2,2-diphenylacetamide.
What is the SMILES notation for N-[[4-(dimethylamino)pyrimidin-2-yl]methyl]-2,2-diphenylacetamide?
The canonical SMILES for N-[[4-(dimethylamino)pyrimidin-2-yl]methyl]-2,2-diphenylacetamide is CN(C)c1ccnc(CNC(=O)C(c2ccccc2)c2ccccc2)n1.
What is the InChIKey of N-[[4-(dimethylamino)pyrimidin-2-yl]methyl]-2,2-diphenylacetamide?
The InChIKey is CPFIBHFJEMQJSF-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H22N4O/c1-25(2)19-13-14-22-18(24-19)15-23-21(26)20(16-9-5-3-6-10-16)17-11-7-4-8-12-17/h3-14,20H,15H2,1-2H3,(H,23,26).
What are the key properties of N-[[4-(dimethylamino)pyrimidin-2-yl]methyl]-2,2-diphenylacetamide?
N-[[4-(dimethylamino)pyrimidin-2-yl]methyl]-2,2-diphenylacetamide has a molecular weight of 346.43 g/mol, XLogP of 2.99, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[[4-(dimethylamino)pyrimidin-2-yl]methyl]-2,2-diphenylacetamide is sourced from PubChem (CID 72718239), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).