(1Z)-4-chloro-N-hydroxybenzenecarboximidoyl chloride

C7H5Cl2NO — CID 7271865

IUPAC(1Z)-4-chloro-N-hydroxybenzenecarboximidoyl chloride
SMILESO/N=C(\Cl)c1ccc(Cl)cc1
InChIInChI=1S/C7H5Cl2NO/c8-6-3-1-5(2-4-6)7(9)10-11/h1-4,11H/b10-7-
InChIKeyJPBNMRDGFBFKLT-YFHOEESVSA-N
MW190.03 g/mol
LogP2.71
Rot. Bonds1

About (1Z)-4-chloro-N-hydroxybenzenecarboximidoyl chloride

(1Z)-4-chloro-N-hydroxybenzenecarboximidoyl chloride (PubChem CID 7271865) has the molecular formula C7H5Cl2NO and a molecular weight of 190.03 g/mol. Its IUPAC name is (1Z)-4-chloro-N-hydroxybenzenecarboximidoyl chloride.

Molecular Properties

Compound Name(1Z)-4-chloro-N-hydroxybenzenecarboximidoyl chloride
PubChem CID7271865
Molecular FormulaC7H5Cl2NO
Molecular Weight190.03 g/mol
Exact Mass188.97
IUPAC Name(1Z)-4-chloro-N-hydroxybenzenecarboximidoyl chloride
SMILESO/N=C(\Cl)c1ccc(Cl)cc1
InChIInChI=1S/C7H5Cl2NO/c8-6-3-1-5(2-4-6)7(9)10-11/h1-4,11H/b10-7-
InChIKeyJPBNMRDGFBFKLT-YFHOEESVSA-N
XLogP2.71
TPSA32.59 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds1
Heavy Atoms11
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500190.03
LogP ≤ 52.71
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}

Analyze (1Z)-4-chloro-N-hydroxybenzenecarboximidoyl chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (1Z)-4-chloro-N-hydroxybenzenecarboximidoyl chloride?
The IUPAC name of (1Z)-4-chloro-N-hydroxybenzenecarboximidoyl chloride (CID 7271865) is (1Z)-4-chloro-N-hydroxybenzenecarboximidoyl chloride.
What is the SMILES notation for (1Z)-4-chloro-N-hydroxybenzenecarboximidoyl chloride?
The canonical SMILES for (1Z)-4-chloro-N-hydroxybenzenecarboximidoyl chloride is O/N=C(\Cl)c1ccc(Cl)cc1.
What is the InChIKey of (1Z)-4-chloro-N-hydroxybenzenecarboximidoyl chloride?
The InChIKey is JPBNMRDGFBFKLT-YFHOEESVSA-N. The full InChI is InChI=1S/C7H5Cl2NO/c8-6-3-1-5(2-4-6)7(9)10-11/h1-4,11H/b10-7-.
What are the key properties of (1Z)-4-chloro-N-hydroxybenzenecarboximidoyl chloride?
(1Z)-4-chloro-N-hydroxybenzenecarboximidoyl chloride has a molecular weight of 190.03 g/mol, XLogP of 2.71, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (1Z)-4-chloro-N-hydroxybenzenecarboximidoyl chloride is sourced from PubChem (CID 7271865), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).