About N-[2-(3,5-dicyclopropylpyrazol-1-yl)ethyl]-2,2-dimethylpropanamide
N-[2-(3,5-dicyclopropylpyrazol-1-yl)ethyl]-2,2-dimethylpropanamide (PubChem CID 72718776) has the molecular formula C16H25N3O
and a molecular weight of 275.40 g/mol. Its IUPAC name is N-[2-(3,5-dicyclopropylpyrazol-1-yl)ethyl]-2,2-dimethylpropanamide.
Molecular Properties
| Compound Name | N-[2-(3,5-dicyclopropylpyrazol-1-yl)ethyl]-2,2-dimethylpropanamide |
| PubChem CID | 72718776 |
| Molecular Formula | C16H25N3O |
| Molecular Weight | 275.40 g/mol |
| Exact Mass | 275.20 |
| IUPAC Name | N-[2-(3,5-dicyclopropylpyrazol-1-yl)ethyl]-2,2-dimethylpropanamide |
| SMILES | CC(C)(C)C(=O)NCCn1nc(C2CC2)cc1C1CC1 |
| InChI | InChI=1S/C16H25N3O/c1-16(2,3)15(20)17-8-9-19-14(12-6-7-12)10-13(18-19)11-4-5-11/h10-12H,4-9H2,1-3H3,(H,17,20) |
| InChIKey | BKUISJIHUIBWGG-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 275.40 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-[2-(3,5-dicyclopropylpyrazol-1-yl)ethyl]-2,2-dimethylpropanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-(3,5-dicyclopropylpyrazol-1-yl)ethyl]-2,2-dimethylpropanamide?
The IUPAC name of N-[2-(3,5-dicyclopropylpyrazol-1-yl)ethyl]-2,2-dimethylpropanamide (CID 72718776) is N-[2-(3,5-dicyclopropylpyrazol-1-yl)ethyl]-2,2-dimethylpropanamide.
What is the SMILES notation for N-[2-(3,5-dicyclopropylpyrazol-1-yl)ethyl]-2,2-dimethylpropanamide?
The canonical SMILES for N-[2-(3,5-dicyclopropylpyrazol-1-yl)ethyl]-2,2-dimethylpropanamide is CC(C)(C)C(=O)NCCn1nc(C2CC2)cc1C1CC1.
What is the InChIKey of N-[2-(3,5-dicyclopropylpyrazol-1-yl)ethyl]-2,2-dimethylpropanamide?
The InChIKey is BKUISJIHUIBWGG-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H25N3O/c1-16(2,3)15(20)17-8-9-19-14(12-6-7-12)10-13(18-19)11-4-5-11/h10-12H,4-9H2,1-3H3,(H,17,20).
What are the key properties of N-[2-(3,5-dicyclopropylpyrazol-1-yl)ethyl]-2,2-dimethylpropanamide?
N-[2-(3,5-dicyclopropylpyrazol-1-yl)ethyl]-2,2-dimethylpropanamide has a molecular weight of 275.40 g/mol, XLogP of 2.80, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-(3,5-dicyclopropylpyrazol-1-yl)ethyl]-2,2-dimethylpropanamide is sourced from PubChem (CID 72718776), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).