C17H23N3O4S — CID 72719017
(3-methoxy-2-methylindazol-6-yl)-[3-(2-methylpropylsulfonyl)azetidin-1-yl]methanone (PubChem CID 72719017) has the molecular formula C17H23N3O4S and a molecular weight of 365.46 g/mol. Its IUPAC name is (3-methoxy-2-methylindazol-6-yl)-[3-(2-methylpropylsulfonyl)azetidin-1-yl]methanone.
| Compound Name | (3-methoxy-2-methylindazol-6-yl)-[3-(2-methylpropylsulfonyl)azetidin-1-yl]methanone |
|---|---|
| PubChem CID | 72719017 |
| Molecular Formula | C17H23N3O4S |
| Molecular Weight | 365.46 g/mol |
| Exact Mass | 365.14 |
| IUPAC Name | (3-methoxy-2-methylindazol-6-yl)-[3-(2-methylpropylsulfonyl)azetidin-1-yl]methanone |
| SMILES | COc1c2ccc(C(=O)N3CC(S(=O)(=O)CC(C)C)C3)cc2nn1C |
| InChI | InChI=1S/C17H23N3O4S/c1-11(2)10-25(22,23)13-8-20(9-13)16(21)12-5-6-14-15(7-12)18-19(3)17(14)24-4/h5-7,11,13H,8-10H2,1-4H3 |
| InChIKey | FPUPTVKWOLCNBQ-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 81.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.46 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |