C13H7F2N5O5 — CID 72720715
N-(2,2-difluoro-5H-[1,3]dioxolo[4,5-f]benzimidazol-6-yl)-4-nitro-1H-pyrrole-2-carboxamide (PubChem CID 72720715) has the molecular formula C13H7F2N5O5 and a molecular weight of 351.23 g/mol. Its IUPAC name is N-(2,2-difluoro-5H-[1,3]dioxolo[4,5-f]benzimidazol-6-yl)-4-nitro-1H-pyrrole-2-carboxamide.
| Compound Name | N-(2,2-difluoro-5H-[1,3]dioxolo[4,5-f]benzimidazol-6-yl)-4-nitro-1H-pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 72720715 |
| Molecular Formula | C13H7F2N5O5 |
| Molecular Weight | 351.23 g/mol |
| Exact Mass | 351.04 |
| IUPAC Name | N-(2,2-difluoro-5H-[1,3]dioxolo[4,5-f]benzimidazol-6-yl)-4-nitro-1H-pyrrole-2-carboxamide |
| SMILES | O=C(Nc1nc2cc3c(cc2[nH]1)OC(F)(F)O3)c1cc([N+](=O)[O-])c[nH]1 |
| InChI | InChI=1S/C13H7F2N5O5/c14-13(15)24-9-2-6-7(3-10(9)25-13)18-12(17-6)19-11(21)8-1-5(4-16-8)20(22)23/h1-4,16H,(H2,17,18,19,21) |
| InChIKey | MJOVNJPQYZSALW-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 135.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.23 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|