C30H52O11 — CID 72721161
1-[(1R,3R,5R,6S,9S,13S,15S,17R)-13-hydroxy-3,9,15-tris(methoxymethoxy)-5,19,19-trimethyl-18,20-dioxapentacyclo[11.8.0.01,17.02,10.05,9]henicosan-6-yl]ethane-1,2-diol (PubChem CID 72721161) has the molecular formula C30H52O11 and a molecular weight of 588.74 g/mol. Its IUPAC name is 1-[(1R,3R,5R,6S,9S,13S,15S,17R)-13-hydroxy-3,9,15-tris(methoxymethoxy)-5,19,19-trimethyl-18,20-dioxapentacyclo[11.8.0.01,17.02,10.05,9]henicosan-6-yl]ethane-1,2-diol.
| Compound Name | 1-[(1R,3R,5R,6S,9S,13S,15S,17R)-13-hydroxy-3,9,15-tris(methoxymethoxy)-5,19,19-trimethyl-18,20-dioxapentacyclo[11.8.0.01,17.02,10.05,9]henicosan-6-yl]ethane-1,2-diol |
|---|---|
| PubChem CID | 72721161 |
| Molecular Formula | C30H52O11 |
| Molecular Weight | 588.74 g/mol |
| Exact Mass | 588.35 |
| IUPAC Name | 1-[(1R,3R,5R,6S,9S,13S,15S,17R)-13-hydroxy-3,9,15-tris(methoxymethoxy)-5,19,19-trimethyl-18,20-dioxapentacyclo[11.8.0.01,17.02,10.05,9]henicosan-6-yl]ethane-1,2-diol |
| SMILES | COCOC1C[C@]2(C)[C@@H](C(O)CO)CC[C@]2(OCOC)C2CC[C@]3(O)C[C@@H](OCOC)C[C@H]4OC(C)(C)OC[C@]43C12 |
| InChI | InChI=1S/C30H52O11/c1-26(2)39-15-29-24(41-26)11-19(37-16-34-4)12-28(29,33)9-7-21-25(29)23(38-17-35-5)13-27(3)20(22(32)14-31)8-10-30(21,27)40-18-36-6/h19-25,31-33H,7-18H2,1-6H3/t19-,20+,21?,22?,23?,24+,25?,27+,28-,29+,30-/m0/s1 |
| InChIKey | NSIGLFHCYUMARH-LWDBTMQGSA-N |
| XLogP | 2.19 |
| TPSA | 134.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.74 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|