C29H47NO9 — CID 72721662
(1R,3R,5R,6S,9S,13S,15S,17R)-13-hydroxy-3,9,15-tris(methoxymethoxy)-5,19,19-trimethyl-18,20-dioxapentacyclo[11.8.0.01,17.02,10.05,9]henicosane-6-carbonitrile (PubChem CID 72721662) has the molecular formula C29H47NO9 and a molecular weight of 553.69 g/mol. Its IUPAC name is (1R,3R,5R,6S,9S,13S,15S,17R)-13-hydroxy-3,9,15-tris(methoxymethoxy)-5,19,19-trimethyl-18,20-dioxapentacyclo[11.8.0.01,17.02,10.05,9]henicosane-6-carbonitrile.
| Compound Name | (1R,3R,5R,6S,9S,13S,15S,17R)-13-hydroxy-3,9,15-tris(methoxymethoxy)-5,19,19-trimethyl-18,20-dioxapentacyclo[11.8.0.01,17.02,10.05,9]henicosane-6-carbonitrile |
|---|---|
| PubChem CID | 72721662 |
| Molecular Formula | C29H47NO9 |
| Molecular Weight | 553.69 g/mol |
| Exact Mass | 553.33 |
| IUPAC Name | (1R,3R,5R,6S,9S,13S,15S,17R)-13-hydroxy-3,9,15-tris(methoxymethoxy)-5,19,19-trimethyl-18,20-dioxapentacyclo[11.8.0.01,17.02,10.05,9]henicosane-6-carbonitrile |
| SMILES | COCOC1C[C@]2(C)[C@@H](C#N)CC[C@]2(OCOC)C2CC[C@]3(O)C[C@@H](OCOC)C[C@H]4OC(C)(C)OC[C@]43C12 |
| InChI | InChI=1S/C29H47NO9/c1-25(2)37-15-28-23(39-25)11-20(35-16-32-4)12-27(28,31)9-8-21-24(28)22(36-17-33-5)13-26(3)19(14-30)7-10-29(21,26)38-18-34-6/h19-24,31H,7-13,15-18H2,1-6H3/t19-,20+,21?,22?,23-,24?,26-,27+,28-,29+/m1/s1 |
| InChIKey | AWRYXSTVVUNIQP-PFUOZSOJSA-N |
| XLogP | 3.36 |
| TPSA | 117.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.69 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|