C22H17F3N2O5S — CID 72721795
2-(3,4-dimethoxyphenyl)-1,1-dioxo-4-[(2,4,6-trifluorophenyl)methyl]-1λ6,2,4-benzothiadiazin-3-one (PubChem CID 72721795) has the molecular formula C22H17F3N2O5S and a molecular weight of 478.45 g/mol. Its IUPAC name is 2-(3,4-dimethoxyphenyl)-1,1-dioxo-4-[(2,4,6-trifluorophenyl)methyl]-1λ6,2,4-benzothiadiazin-3-one.
| Compound Name | 2-(3,4-dimethoxyphenyl)-1,1-dioxo-4-[(2,4,6-trifluorophenyl)methyl]-1λ6,2,4-benzothiadiazin-3-one |
|---|---|
| PubChem CID | 72721795 |
| Molecular Formula | C22H17F3N2O5S |
| Molecular Weight | 478.45 g/mol |
| Exact Mass | 478.08 |
| IUPAC Name | 2-(3,4-dimethoxyphenyl)-1,1-dioxo-4-[(2,4,6-trifluorophenyl)methyl]-1λ6,2,4-benzothiadiazin-3-one |
| SMILES | COc1ccc(N2C(=O)N(Cc3c(F)cc(F)cc3F)c3ccccc3S2(=O)=O)cc1OC |
| InChI | InChI=1S/C22H17F3N2O5S/c1-31-19-8-7-14(11-20(19)32-2)27-22(28)26(12-15-16(24)9-13(23)10-17(15)25)18-5-3-4-6-21(18)33(27,29)30/h3-11H,12H2,1-2H3 |
| InChIKey | IMYZYCPBPQRRCC-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 76.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.45 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |