C13H18N2O4S — CID 7272189
(1S,2R,3R)-1-[(2R)-5-(4-methylphenyl)-2,3-dihydro-1,3,4-thiadiazol-2-yl]butane-1,2,3,4-tetrol (PubChem CID 7272189) has the molecular formula C13H18N2O4S and a molecular weight of 298.36 g/mol. Its IUPAC name is (1S,2R,3R)-1-[(2R)-5-(4-methylphenyl)-2,3-dihydro-1,3,4-thiadiazol-2-yl]butane-1,2,3,4-tetrol.
| Compound Name | (1S,2R,3R)-1-[(2R)-5-(4-methylphenyl)-2,3-dihydro-1,3,4-thiadiazol-2-yl]butane-1,2,3,4-tetrol |
|---|---|
| PubChem CID | 7272189 |
| Molecular Formula | C13H18N2O4S |
| Molecular Weight | 298.36 g/mol |
| Exact Mass | 298.10 |
| IUPAC Name | (1S,2R,3R)-1-[(2R)-5-(4-methylphenyl)-2,3-dihydro-1,3,4-thiadiazol-2-yl]butane-1,2,3,4-tetrol |
| SMILES | Cc1ccc(C2=NN[C@@H]([C@@H](O)[C@H](O)[C@H](O)CO)S2)cc1 |
| InChI | InChI=1S/C13H18N2O4S/c1-7-2-4-8(5-3-7)12-14-15-13(20-12)11(19)10(18)9(17)6-16/h2-5,9-11,13,15-19H,6H2,1H3/t9-,10-,11+,13-/m1/s1 |
| InChIKey | OKAFFSMYYKLSPP-HNCHTBHHSA-N |
| XLogP | -0.61 |
| TPSA | 105.31 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.36 |
| LogP ≤ 5 | -0.61 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |