C26H18ClN5O7S — CID 72722275
1-[2-[(5Z)-5-[(2-chloro-6-methoxyquinolin-3-yl)methylidene]-2-(2-hydroxyphenyl)imino-4-oxo-1,3-thiazolidin-3-yl]-2-oxoethyl]-1,3-diazinane-2,4,6-trione (PubChem CID 72722275) has the molecular formula C26H18ClN5O7S and a molecular weight of 579.98 g/mol. Its IUPAC name is 1-[2-[(5Z)-5-[(2-chloro-6-methoxyquinolin-3-yl)methylidene]-2-(2-hydroxyphenyl)imino-4-oxo-1,3-thiazolidin-3-yl]-2-oxoethyl]-1,3-diazinane-2,4,6-trione.
| Compound Name | 1-[2-[(5Z)-5-[(2-chloro-6-methoxyquinolin-3-yl)methylidene]-2-(2-hydroxyphenyl)imino-4-oxo-1,3-thiazolidin-3-yl]-2-oxoethyl]-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 72722275 |
| Molecular Formula | C26H18ClN5O7S |
| Molecular Weight | 579.98 g/mol |
| Exact Mass | 579.06 |
| IUPAC Name | 1-[2-[(5Z)-5-[(2-chloro-6-methoxyquinolin-3-yl)methylidene]-2-(2-hydroxyphenyl)imino-4-oxo-1,3-thiazolidin-3-yl]-2-oxoethyl]-1,3-diazinane-2,4,6-trione |
| SMILES | COc1ccc2nc(Cl)c(/C=C3\S/C(=N\c4ccccc4O)N(C(=O)CN4C(=O)CC(=O)NC4=O)C3=O)cc2c1 |
| InChI | InChI=1S/C26H18ClN5O7S/c1-39-15-6-7-16-13(9-15)8-14(23(27)28-16)10-19-24(37)32(26(40-19)29-17-4-2-3-5-18(17)33)22(36)12-31-21(35)11-20(34)30-25(31)38/h2-10,33H,11-12H2,1H3,(H,30,34,38)/b19-10-,29-26- |
| InChIKey | NAZVURMOUKJVCT-ROMHXKRMSA-N |
| XLogP | 3.20 |
| TPSA | 158.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.98 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_phenol_A(3)', 'substructure': 'N/A'}, {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|