C18H22F2N4O3S — CID 72722440
(2R,3S,5R)-2-(2,5-difluorophenyl)-5-methyl-5-(2-methylsulfonyl-4,6-dihydropyrrolo[3,4-c]pyrazol-5-yl)oxan-3-amine (PubChem CID 72722440) has the molecular formula C18H22F2N4O3S and a molecular weight of 412.46 g/mol. Its IUPAC name is (2R,3S,5R)-2-(2,5-difluorophenyl)-5-methyl-5-(2-methylsulfonyl-4,6-dihydropyrrolo[3,4-c]pyrazol-5-yl)oxan-3-amine.
| Compound Name | (2R,3S,5R)-2-(2,5-difluorophenyl)-5-methyl-5-(2-methylsulfonyl-4,6-dihydropyrrolo[3,4-c]pyrazol-5-yl)oxan-3-amine |
|---|---|
| PubChem CID | 72722440 |
| Molecular Formula | C18H22F2N4O3S |
| Molecular Weight | 412.46 g/mol |
| Exact Mass | 412.14 |
| IUPAC Name | (2R,3S,5R)-2-(2,5-difluorophenyl)-5-methyl-5-(2-methylsulfonyl-4,6-dihydropyrrolo[3,4-c]pyrazol-5-yl)oxan-3-amine |
| SMILES | C[C@]1(N2Cc3cn(S(C)(=O)=O)nc3C2)CO[C@H](c2cc(F)ccc2F)[C@@H](N)C1 |
| InChI | InChI=1S/C18H22F2N4O3S/c1-18(23-7-11-8-24(28(2,25)26)22-16(11)9-23)6-15(21)17(27-10-18)13-5-12(19)3-4-14(13)20/h3-5,8,15,17H,6-7,9-10,21H2,1-2H3/t15-,17+,18+/m0/s1 |
| InChIKey | YEPZZFPPSSQKOU-CGTJXYLNSA-N |
| XLogP | 1.53 |
| TPSA | 90.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.46 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |