C19H18F6N2O4S — CID 72722445
N-[2-[N-(benzenesulfonyl)-4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)anilino]ethyl]acetamide (PubChem CID 72722445) has the molecular formula C19H18F6N2O4S and a molecular weight of 484.42 g/mol. Its IUPAC name is N-[2-[N-(benzenesulfonyl)-4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)anilino]ethyl]acetamide.
| Compound Name | N-[2-[N-(benzenesulfonyl)-4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)anilino]ethyl]acetamide |
|---|---|
| PubChem CID | 72722445 |
| Molecular Formula | C19H18F6N2O4S |
| Molecular Weight | 484.42 g/mol |
| Exact Mass | 484.09 |
| IUPAC Name | N-[2-[N-(benzenesulfonyl)-4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)anilino]ethyl]acetamide |
| SMILES | CC(=O)NCCN(c1ccc(C(O)(C(F)(F)F)C(F)(F)F)cc1)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C19H18F6N2O4S/c1-13(28)26-11-12-27(32(30,31)16-5-3-2-4-6-16)15-9-7-14(8-10-15)17(29,18(20,21)22)19(23,24)25/h2-10,29H,11-12H2,1H3,(H,26,28) |
| InChIKey | ZOTCGJSUBOIQLX-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.42 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |