C17H19F3O3 — CID 72722530
trans-tert-butyl (1R,2S)-1-acetyl-2-[4-(trifluoromethyl)phenyl]cyclopropane-1-carboxylate (PubChem CID 72722530) has the molecular formula C17H19F3O3 and a molecular weight of 328.33 g/mol. Its IUPAC name is trans-tert-butyl (1R,2S)-1-acetyl-2-[4-(trifluoromethyl)phenyl]cyclopropane-1-carboxylate.
| Compound Name | trans-tert-butyl (1R,2S)-1-acetyl-2-[4-(trifluoromethyl)phenyl]cyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 72722530 |
| Molecular Formula | C17H19F3O3 |
| Molecular Weight | 328.33 g/mol |
| Exact Mass | 328.13 |
| IUPAC Name | trans-tert-butyl (1R,2S)-1-acetyl-2-[4-(trifluoromethyl)phenyl]cyclopropane-1-carboxylate |
| SMILES | CC(=O)[C@@]1(C(=O)OC(C)(C)C)C[C@H]1c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C17H19F3O3/c1-10(21)16(14(22)23-15(2,3)4)9-13(16)11-5-7-12(8-6-11)17(18,19)20/h5-8,13H,9H2,1-4H3/t13-,16-/m0/s1 |
| InChIKey | DYDNFDPPDGWVTR-BBRMVZONSA-N |
| XLogP | 4.11 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.33 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|