C28H37N3O — CID 72722569
(3aS,6S,6aS)-3a-methyl-1,3-diphenyl-6-(2,2,6,6-tetramethylpiperidin-1-yl)oxy-4,5,6,6a-tetrahydrocyclopenta[c]pyrazole (PubChem CID 72722569) has the molecular formula C28H37N3O and a molecular weight of 431.62 g/mol. Its IUPAC name is (3aS,6S,6aS)-3a-methyl-1,3-diphenyl-6-(2,2,6,6-tetramethylpiperidin-1-yl)oxy-4,5,6,6a-tetrahydrocyclopenta[c]pyrazole.
| Compound Name | (3aS,6S,6aS)-3a-methyl-1,3-diphenyl-6-(2,2,6,6-tetramethylpiperidin-1-yl)oxy-4,5,6,6a-tetrahydrocyclopenta[c]pyrazole |
|---|---|
| PubChem CID | 72722569 |
| Molecular Formula | C28H37N3O |
| Molecular Weight | 431.62 g/mol |
| Exact Mass | 431.29 |
| IUPAC Name | (3aS,6S,6aS)-3a-methyl-1,3-diphenyl-6-(2,2,6,6-tetramethylpiperidin-1-yl)oxy-4,5,6,6a-tetrahydrocyclopenta[c]pyrazole |
| SMILES | CC1(C)CCCC(C)(C)N1O[C@H]1CC[C@]2(C)C(c3ccccc3)=NN(c3ccccc3)[C@H]12 |
| InChI | InChI=1S/C28H37N3O/c1-26(2)18-12-19-27(3,4)31(26)32-23-17-20-28(5)24(21-13-8-6-9-14-21)29-30(25(23)28)22-15-10-7-11-16-22/h6-11,13-16,23,25H,12,17-20H2,1-5H3/t23-,25+,28+/m0/s1 |
| InChIKey | FCFRUZJGLFIVGO-KSCKTEMCSA-N |
| XLogP | 6.42 |
| TPSA | 28.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.62 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |