C29H39N3O — CID 72722570
(3aS,7S,7aS)-3a-methyl-1,3-diphenyl-7-(2,2,6,6-tetramethylpiperidin-1-yl)oxy-5,6,7,7a-tetrahydro-4H-indazole (PubChem CID 72722570) has the molecular formula C29H39N3O and a molecular weight of 445.65 g/mol. Its IUPAC name is (3aS,7S,7aS)-3a-methyl-1,3-diphenyl-7-(2,2,6,6-tetramethylpiperidin-1-yl)oxy-5,6,7,7a-tetrahydro-4H-indazole.
| Compound Name | (3aS,7S,7aS)-3a-methyl-1,3-diphenyl-7-(2,2,6,6-tetramethylpiperidin-1-yl)oxy-5,6,7,7a-tetrahydro-4H-indazole |
|---|---|
| PubChem CID | 72722570 |
| Molecular Formula | C29H39N3O |
| Molecular Weight | 445.65 g/mol |
| Exact Mass | 445.31 |
| IUPAC Name | (3aS,7S,7aS)-3a-methyl-1,3-diphenyl-7-(2,2,6,6-tetramethylpiperidin-1-yl)oxy-5,6,7,7a-tetrahydro-4H-indazole |
| SMILES | CC1(C)CCCC(C)(C)N1O[C@H]1CCC[C@]2(C)C(c3ccccc3)=NN(c3ccccc3)[C@H]12 |
| InChI | InChI=1S/C29H39N3O/c1-27(2)19-13-20-28(3,4)32(27)33-24-18-12-21-29(5)25(22-14-8-6-9-15-22)30-31(26(24)29)23-16-10-7-11-17-23/h6-11,14-17,24,26H,12-13,18-21H2,1-5H3/t24-,26+,29+/m0/s1 |
| InChIKey | YZEKOFWKGIZGFK-IHTKTJBKSA-N |
| XLogP | 6.81 |
| TPSA | 28.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.65 |
| LogP ≤ 5 | 6.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |