C37H56N4O2 — CID 72722571
1-[(1R)-1-[(3R)-4,4-dimethyl-2,5-diphenyl-3H-pyrazol-3-yl]-2-(2,2,6,6-tetramethylpiperidin-1-yl)oxyethoxy]-2,2,6,6-tetramethylpiperidine (PubChem CID 72722571) has the molecular formula C37H56N4O2 and a molecular weight of 588.88 g/mol. Its IUPAC name is 1-[(1R)-1-[(3R)-4,4-dimethyl-2,5-diphenyl-3H-pyrazol-3-yl]-2-(2,2,6,6-tetramethylpiperidin-1-yl)oxyethoxy]-2,2,6,6-tetramethylpiperidine.
| Compound Name | 1-[(1R)-1-[(3R)-4,4-dimethyl-2,5-diphenyl-3H-pyrazol-3-yl]-2-(2,2,6,6-tetramethylpiperidin-1-yl)oxyethoxy]-2,2,6,6-tetramethylpiperidine |
|---|---|
| PubChem CID | 72722571 |
| Molecular Formula | C37H56N4O2 |
| Molecular Weight | 588.88 g/mol |
| Exact Mass | 588.44 |
| IUPAC Name | 1-[(1R)-1-[(3R)-4,4-dimethyl-2,5-diphenyl-3H-pyrazol-3-yl]-2-(2,2,6,6-tetramethylpiperidin-1-yl)oxyethoxy]-2,2,6,6-tetramethylpiperidine |
| SMILES | CC1(C)C(c2ccccc2)=NN(c2ccccc2)[C@H]1[C@H](CON1C(C)(C)CCCC1(C)C)ON1C(C)(C)CCCC1(C)C |
| InChI | InChI=1S/C37H56N4O2/c1-33(2)23-17-24-34(3,4)40(33)42-27-30(43-41-35(5,6)25-18-26-36(41,7)8)32-37(9,10)31(28-19-13-11-14-20-28)38-39(32)29-21-15-12-16-22-29/h11-16,19-22,30,32H,17-18,23-27H2,1-10H3/t30-,32-/m0/s1 |
| InChIKey | KRJPNBCEPHDJNV-CDZUIXILSA-N |
| XLogP | 8.62 |
| TPSA | 40.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.88 |
| LogP ≤ 5 | 8.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |