About trans-(2R,3S)-3-[(E)-hex-1-enyl]-2-(oxan-2-yloxymethyl)cyclopentan-1-one
trans-(2R,3S)-3-[(E)-hex-1-enyl]-2-(oxan-2-yloxymethyl)cyclopentan-1-one (PubChem CID 72722686) has the molecular formula C17H28O3
and a molecular weight of 280.41 g/mol. Its IUPAC name is trans-(2R,3S)-3-[(E)-hex-1-enyl]-2-(oxan-2-yloxymethyl)cyclopentan-1-one.
Molecular Properties
| Compound Name | trans-(2R,3S)-3-[(E)-hex-1-enyl]-2-(oxan-2-yloxymethyl)cyclopentan-1-one |
| PubChem CID | 72722686 |
| Molecular Formula | C17H28O3 |
| Molecular Weight | 280.41 g/mol |
| Exact Mass | 280.20 |
| IUPAC Name | trans-(2R,3S)-3-[(E)-hex-1-enyl]-2-(oxan-2-yloxymethyl)cyclopentan-1-one |
| SMILES | CCCC/C=C/[C@@H]1CCC(=O)[C@H]1COC1CCCCO1 |
| InChI | InChI=1S/C17H28O3/c1-2-3-4-5-8-14-10-11-16(18)15(14)13-20-17-9-6-7-12-19-17/h5,8,14-15,17H,2-4,6-7,9-13H2,1H3/b8-5+/t14-,15+,17?/m1/s1 |
| InChIKey | RHBAWJFSOGJRHL-KZAYDCIJSA-N |
| XLogP | 3.87 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 280.41 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze trans-(2R,3S)-3-[(E)-hex-1-enyl]-2-(oxan-2-yloxymethyl)cyclopentan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of trans-(2R,3S)-3-[(E)-hex-1-enyl]-2-(oxan-2-yloxymethyl)cyclopentan-1-one?
The IUPAC name of trans-(2R,3S)-3-[(E)-hex-1-enyl]-2-(oxan-2-yloxymethyl)cyclopentan-1-one (CID 72722686) is trans-(2R,3S)-3-[(E)-hex-1-enyl]-2-(oxan-2-yloxymethyl)cyclopentan-1-one.
What is the SMILES notation for trans-(2R,3S)-3-[(E)-hex-1-enyl]-2-(oxan-2-yloxymethyl)cyclopentan-1-one?
The canonical SMILES for trans-(2R,3S)-3-[(E)-hex-1-enyl]-2-(oxan-2-yloxymethyl)cyclopentan-1-one is CCCC/C=C/[C@@H]1CCC(=O)[C@H]1COC1CCCCO1.
What is the InChIKey of trans-(2R,3S)-3-[(E)-hex-1-enyl]-2-(oxan-2-yloxymethyl)cyclopentan-1-one?
The InChIKey is RHBAWJFSOGJRHL-KZAYDCIJSA-N. The full InChI is InChI=1S/C17H28O3/c1-2-3-4-5-8-14-10-11-16(18)15(14)13-20-17-9-6-7-12-19-17/h5,8,14-15,17H,2-4,6-7,9-13H2,1H3/b8-5+/t14-,15+,17?/m1/s1.
What are the key properties of trans-(2R,3S)-3-[(E)-hex-1-enyl]-2-(oxan-2-yloxymethyl)cyclopentan-1-one?
trans-(2R,3S)-3-[(E)-hex-1-enyl]-2-(oxan-2-yloxymethyl)cyclopentan-1-one has a molecular weight of 280.41 g/mol, XLogP of 3.87, 7 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for trans-(2R,3S)-3-[(E)-hex-1-enyl]-2-(oxan-2-yloxymethyl)cyclopentan-1-one is sourced from PubChem (CID 72722686), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).