About (6S)-8-diazo-2,6-dimethyloct-2-ene
(6S)-8-diazo-2,6-dimethyloct-2-ene (PubChem CID 72722697) has the molecular formula C10H18N2
and a molecular weight of 166.27 g/mol. Its IUPAC name is (6S)-8-diazo-2,6-dimethyloct-2-ene.
Molecular Properties
| Compound Name | (6S)-8-diazo-2,6-dimethyloct-2-ene |
| PubChem CID | 72722697 |
| Molecular Formula | C10H18N2 |
| Molecular Weight | 166.27 g/mol |
| Exact Mass | 166.15 |
| IUPAC Name | (6S)-8-diazo-2,6-dimethyloct-2-ene |
| SMILES | CC(C)=CCC[C@H](C)CC=[N+]=[N-] |
| InChI | InChI=1S/C10H18N2/c1-9(2)5-4-6-10(3)7-8-12-11/h5,8,10H,4,6-7H2,1-3H3/t10-/m0/s1 |
| InChIKey | OCNRIPWAADPSEQ-JTQLQIEISA-N |
| XLogP | 3.06 |
| TPSA | 36.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 166.27 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze (6S)-8-diazo-2,6-dimethyloct-2-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6S)-8-diazo-2,6-dimethyloct-2-ene?
The IUPAC name of (6S)-8-diazo-2,6-dimethyloct-2-ene (CID 72722697) is (6S)-8-diazo-2,6-dimethyloct-2-ene.
What is the SMILES notation for (6S)-8-diazo-2,6-dimethyloct-2-ene?
The canonical SMILES for (6S)-8-diazo-2,6-dimethyloct-2-ene is CC(C)=CCC[C@H](C)CC=[N+]=[N-].
What is the InChIKey of (6S)-8-diazo-2,6-dimethyloct-2-ene?
The InChIKey is OCNRIPWAADPSEQ-JTQLQIEISA-N. The full InChI is InChI=1S/C10H18N2/c1-9(2)5-4-6-10(3)7-8-12-11/h5,8,10H,4,6-7H2,1-3H3/t10-/m0/s1.
What are the key properties of (6S)-8-diazo-2,6-dimethyloct-2-ene?
(6S)-8-diazo-2,6-dimethyloct-2-ene has a molecular weight of 166.27 g/mol, XLogP of 3.06, 5 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for (6S)-8-diazo-2,6-dimethyloct-2-ene is sourced from PubChem (CID 72722697), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).