C28H39N3O — CID 72722708
4,4-dimethyl-2,6-diphenyl-3-[(2,2,6,6-tetramethylpiperidin-1-yl)oxymethyl]-3,5-dihydropyridazine (PubChem CID 72722708) has the molecular formula C28H39N3O and a molecular weight of 433.64 g/mol. Its IUPAC name is 4,4-dimethyl-2,6-diphenyl-3-[(2,2,6,6-tetramethylpiperidin-1-yl)oxymethyl]-3,5-dihydropyridazine.
| Compound Name | 4,4-dimethyl-2,6-diphenyl-3-[(2,2,6,6-tetramethylpiperidin-1-yl)oxymethyl]-3,5-dihydropyridazine |
|---|---|
| PubChem CID | 72722708 |
| Molecular Formula | C28H39N3O |
| Molecular Weight | 433.64 g/mol |
| Exact Mass | 433.31 |
| IUPAC Name | 4,4-dimethyl-2,6-diphenyl-3-[(2,2,6,6-tetramethylpiperidin-1-yl)oxymethyl]-3,5-dihydropyridazine |
| SMILES | CC1(C)CC(c2ccccc2)=NN(c2ccccc2)C1CON1C(C)(C)CCCC1(C)C |
| InChI | InChI=1S/C28H39N3O/c1-26(2)20-24(22-14-9-7-10-15-22)29-30(23-16-11-8-12-17-23)25(26)21-32-31-27(3,4)18-13-19-28(31,5)6/h7-12,14-17,25H,13,18-21H2,1-6H3 |
| InChIKey | ZBSYEKDDTRTZBA-UHFFFAOYSA-N |
| XLogP | 6.67 |
| TPSA | 28.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.64 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |