C33H41N3O — CID 72722709
4-methyl-2,4,6-triphenyl-3-[(2,2,6,6-tetramethylpiperidin-1-yl)oxymethyl]-3,5-dihydropyridazine (PubChem CID 72722709) has the molecular formula C33H41N3O and a molecular weight of 495.71 g/mol. Its IUPAC name is 4-methyl-2,4,6-triphenyl-3-[(2,2,6,6-tetramethylpiperidin-1-yl)oxymethyl]-3,5-dihydropyridazine.
| Compound Name | 4-methyl-2,4,6-triphenyl-3-[(2,2,6,6-tetramethylpiperidin-1-yl)oxymethyl]-3,5-dihydropyridazine |
|---|---|
| PubChem CID | 72722709 |
| Molecular Formula | C33H41N3O |
| Molecular Weight | 495.71 g/mol |
| Exact Mass | 495.32 |
| IUPAC Name | 4-methyl-2,4,6-triphenyl-3-[(2,2,6,6-tetramethylpiperidin-1-yl)oxymethyl]-3,5-dihydropyridazine |
| SMILES | CC1(c2ccccc2)CC(c2ccccc2)=NN(c2ccccc2)C1CON1C(C)(C)CCCC1(C)C |
| InChI | InChI=1S/C33H41N3O/c1-31(2)22-15-23-32(3,4)36(31)37-25-30-33(5,27-18-11-7-12-19-27)24-29(26-16-9-6-10-17-26)34-35(30)28-20-13-8-14-21-28/h6-14,16-21,30H,15,22-25H2,1-5H3 |
| InChIKey | FZRVVJOZEUYIQP-UHFFFAOYSA-N |
| XLogP | 7.60 |
| TPSA | 28.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.71 |
| LogP ≤ 5 | 7.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |