C15H12F9N3O3S — CID 72722947
N-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-1-methyl-N-(2,2,2-trifluoroethyl)pyrazole-3-sulfonamide (PubChem CID 72722947) has the molecular formula C15H12F9N3O3S and a molecular weight of 485.33 g/mol. Its IUPAC name is N-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-1-methyl-N-(2,2,2-trifluoroethyl)pyrazole-3-sulfonamide.
| Compound Name | N-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-1-methyl-N-(2,2,2-trifluoroethyl)pyrazole-3-sulfonamide |
|---|---|
| PubChem CID | 72722947 |
| Molecular Formula | C15H12F9N3O3S |
| Molecular Weight | 485.33 g/mol |
| Exact Mass | 485.05 |
| IUPAC Name | N-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-1-methyl-N-(2,2,2-trifluoroethyl)pyrazole-3-sulfonamide |
| SMILES | Cn1ccc(S(=O)(=O)N(CC(F)(F)F)c2ccc(C(O)(C(F)(F)F)C(F)(F)F)cc2)n1 |
| InChI | InChI=1S/C15H12F9N3O3S/c1-26-7-6-11(25-26)31(29,30)27(8-12(16,17)18)10-4-2-9(3-5-10)13(28,14(19,20)21)15(22,23)24/h2-7,28H,8H2,1H3 |
| InChIKey | UMJPVYQCPWNHLC-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.33 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |