C12H18O3 — CID 72723100
cis-ethyl (1R,2S)-2-ethenyl-2-methyl-4-oxocyclohexane-1-carboxylate (PubChem CID 72723100) has the molecular formula C12H18O3 and a molecular weight of 210.27 g/mol. Its IUPAC name is cis-ethyl (1R,2S)-2-ethenyl-2-methyl-4-oxocyclohexane-1-carboxylate.
| Compound Name | cis-ethyl (1R,2S)-2-ethenyl-2-methyl-4-oxocyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 72723100 |
| Molecular Formula | C12H18O3 |
| Molecular Weight | 210.27 g/mol |
| Exact Mass | 210.13 |
| IUPAC Name | cis-ethyl (1R,2S)-2-ethenyl-2-methyl-4-oxocyclohexane-1-carboxylate |
| SMILES | C=C[C@]1(C)CC(=O)CC[C@H]1C(=O)OCC |
| InChI | InChI=1S/C12H18O3/c1-4-12(3)8-9(13)6-7-10(12)11(14)15-5-2/h4,10H,1,5-8H2,2-3H3/t10-,12+/m0/s1 |
| InChIKey | ZAJXFFLVRNLDSE-CMPLNLGQSA-N |
| XLogP | 2.11 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.27 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|