About (1R)-1'-benzyl-1-(2-fluoroethyl)spiro[1H-2-benzofuran-3,4'-piperidine]
(1R)-1'-benzyl-1-(2-fluoroethyl)spiro[1H-2-benzofuran-3,4'-piperidine] (PubChem CID 72723327) has the molecular formula C21H24FNO
and a molecular weight of 325.43 g/mol. Its IUPAC name is (1R)-1'-benzyl-1-(2-fluoroethyl)spiro[1H-2-benzofuran-3,4'-piperidine].
Molecular Properties
| Compound Name | (1R)-1'-benzyl-1-(2-fluoroethyl)spiro[1H-2-benzofuran-3,4'-piperidine] |
| PubChem CID | 72723327 |
| Molecular Formula | C21H24FNO |
| Molecular Weight | 325.43 g/mol |
| Exact Mass | 325.18 |
| IUPAC Name | (1R)-1'-benzyl-1-(2-fluoroethyl)spiro[1H-2-benzofuran-3,4'-piperidine] |
| SMILES | FCC[C@H]1OC2(CCN(Cc3ccccc3)CC2)c2ccccc21 |
| InChI | InChI=1S/C21H24FNO/c22-13-10-20-18-8-4-5-9-19(18)21(24-20)11-14-23(15-12-21)16-17-6-2-1-3-7-17/h1-9,20H,10-16H2/t20-/m1/s1 |
| InChIKey | LDFPQKADFLEDQV-HXUWFJFHSA-N |
| XLogP | 4.61 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 325.43 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (1R)-1'-benzyl-1-(2-fluoroethyl)spiro[1H-2-benzofuran-3,4'-piperidine] with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1R)-1'-benzyl-1-(2-fluoroethyl)spiro[1H-2-benzofuran-3,4'-piperidine]?
The IUPAC name of (1R)-1'-benzyl-1-(2-fluoroethyl)spiro[1H-2-benzofuran-3,4'-piperidine] (CID 72723327) is (1R)-1'-benzyl-1-(2-fluoroethyl)spiro[1H-2-benzofuran-3,4'-piperidine].
What is the SMILES notation for (1R)-1'-benzyl-1-(2-fluoroethyl)spiro[1H-2-benzofuran-3,4'-piperidine]?
The canonical SMILES for (1R)-1'-benzyl-1-(2-fluoroethyl)spiro[1H-2-benzofuran-3,4'-piperidine] is FCC[C@H]1OC2(CCN(Cc3ccccc3)CC2)c2ccccc21.
What is the InChIKey of (1R)-1'-benzyl-1-(2-fluoroethyl)spiro[1H-2-benzofuran-3,4'-piperidine]?
The InChIKey is LDFPQKADFLEDQV-HXUWFJFHSA-N. The full InChI is InChI=1S/C21H24FNO/c22-13-10-20-18-8-4-5-9-19(18)21(24-20)11-14-23(15-12-21)16-17-6-2-1-3-7-17/h1-9,20H,10-16H2/t20-/m1/s1.
What are the key properties of (1R)-1'-benzyl-1-(2-fluoroethyl)spiro[1H-2-benzofuran-3,4'-piperidine]?
(1R)-1'-benzyl-1-(2-fluoroethyl)spiro[1H-2-benzofuran-3,4'-piperidine] has a molecular weight of 325.43 g/mol, XLogP of 4.61, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (1R)-1'-benzyl-1-(2-fluoroethyl)spiro[1H-2-benzofuran-3,4'-piperidine] is sourced from PubChem (CID 72723327), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).